From 49fa5aa2a127bdf8924d02bf77e5086b39c7a447 Mon Sep 17 00:00:00 2001 From: Calvin Morrison Date: Wed, 3 Sep 2025 21:15:36 -0400 Subject: i vibe coded it --- server/_build/default/lib/jsx/LICENSE | 21 + server/_build/default/lib/jsx/README.md | 696 +++++++ server/_build/default/lib/jsx/ebin/jsx.app | 10 + server/_build/default/lib/jsx/ebin/jsx.beam | Bin 0 -> 5536 bytes server/_build/default/lib/jsx/ebin/jsx_config.beam | Bin 0 -> 9096 bytes .../_build/default/lib/jsx/ebin/jsx_consult.beam | Bin 0 -> 3320 bytes .../_build/default/lib/jsx/ebin/jsx_decoder.beam | Bin 0 -> 65684 bytes .../_build/default/lib/jsx/ebin/jsx_encoder.beam | Bin 0 -> 4316 bytes server/_build/default/lib/jsx/ebin/jsx_parser.beam | Bin 0 -> 32784 bytes .../_build/default/lib/jsx/ebin/jsx_to_json.beam | Bin 0 -> 10160 bytes .../_build/default/lib/jsx/ebin/jsx_to_term.beam | Bin 0 -> 7544 bytes server/_build/default/lib/jsx/ebin/jsx_verify.beam | Bin 0 -> 3556 bytes server/_build/default/lib/jsx/hex_metadata.config | 15 + server/_build/default/lib/jsx/rebar.config | 17 + server/_build/default/lib/jsx/rebar.lock | 1 + server/_build/default/lib/jsx/src/jsx.app.src | 10 + server/_build/default/lib/jsx/src/jsx.erl | 506 ++++++ server/_build/default/lib/jsx/src/jsx_config.erl | 393 ++++ server/_build/default/lib/jsx/src/jsx_config.hrl | 18 + server/_build/default/lib/jsx/src/jsx_consult.erl | 81 + server/_build/default/lib/jsx/src/jsx_decoder.erl | 1909 ++++++++++++++++++++ server/_build/default/lib/jsx/src/jsx_encoder.erl | 116 ++ server/_build/default/lib/jsx/src/jsx_parser.erl | 1214 +++++++++++++ server/_build/default/lib/jsx/src/jsx_to_json.erl | 408 +++++ server/_build/default/lib/jsx/src/jsx_to_term.erl | 389 ++++ server/_build/default/lib/jsx/src/jsx_verify.erl | 121 ++ 26 files changed, 5925 insertions(+) create mode 100644 server/_build/default/lib/jsx/LICENSE create mode 100644 server/_build/default/lib/jsx/README.md create mode 100644 server/_build/default/lib/jsx/ebin/jsx.app create mode 100644 server/_build/default/lib/jsx/ebin/jsx.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_config.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_consult.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_decoder.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_encoder.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_parser.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_to_json.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_to_term.beam create mode 100644 server/_build/default/lib/jsx/ebin/jsx_verify.beam create mode 100644 server/_build/default/lib/jsx/hex_metadata.config create mode 100644 server/_build/default/lib/jsx/rebar.config create mode 100644 server/_build/default/lib/jsx/rebar.lock create mode 100644 server/_build/default/lib/jsx/src/jsx.app.src create mode 100644 server/_build/default/lib/jsx/src/jsx.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_config.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_config.hrl create mode 100644 server/_build/default/lib/jsx/src/jsx_consult.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_decoder.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_encoder.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_parser.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_to_json.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_to_term.erl create mode 100644 server/_build/default/lib/jsx/src/jsx_verify.erl (limited to 'server/_build/default/lib/jsx') diff --git a/server/_build/default/lib/jsx/LICENSE b/server/_build/default/lib/jsx/LICENSE new file mode 100644 index 0000000..de1b470 --- /dev/null +++ b/server/_build/default/lib/jsx/LICENSE @@ -0,0 +1,21 @@ +The MIT License + +Copyright (c) 2010-2013 alisdair sullivan + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/server/_build/default/lib/jsx/README.md b/server/_build/default/lib/jsx/README.md new file mode 100644 index 0000000..f4e27ce --- /dev/null +++ b/server/_build/default/lib/jsx/README.md @@ -0,0 +1,696 @@ +# jsx (v3.0.0) # + + +an erlang application for consuming, producing and manipulating [json][json]. +inspired by [yajl][yajl] + +**jsx** is built via [rebar3][rebar3] + +current status: ![](https://github.com/talentdeficit/jsx/workflows/EUnit/badge.svg) + +**jsx** is released under the terms of the [MIT][MIT] license + +copyright 2010-2016 alisdair sullivan + +## index ## + +* [quickstart](#quickstart) +* [description](#description) + - [migrating from 1.x](#migrating) + - [json <-> erlang mapping](#json---erlang-mapping) + - [incomplete input](#incomplete-input) +* [data types](#data-types) + - [`json_term()`](#json_term) + - [`json_text()`](#json_text) + - [`event()`](#event) + - [`option()`](#option) +* [exports](#exports) + - [`encoder/3`, `decoder/3` & `parser/3`](#encoder3-decoder3--parser3) + - [`decode/1,2`](#decode12) + - [`encode/1,2`](#encode12) + - [`format/1,2`](#format12) + - [`minify/1`](#minify1) + - [`prettify/1`](#prettify1) + - [`is_json/1,2`](#is_json12) + - [`is_term/1,2`](#is_term12) +* [callback exports](#callback_exports) + - [`Module:init/1`](#moduleinit1) + - [`Module:handle_event/2`](#modulehandle_event2) +* [acknowledgements](#acknowledgements) + + +## quickstart ## + +#### to add to a rebar3 project #### +Add to `rebar.config` +```erlang +... +{erl_opts, [debug_info]}. +{deps, [ + ... + {jsx, "~> 3.0"} +]}. +... +``` + +#### to build the library and run tests #### + +```bash +$ rebar3 compile +$ rebar3 eunit +``` + +#### to convert a utf8 binary containing a json string into an erlang term #### + +```erlang +1> jsx:decode(<<"{\"library\": \"jsx\", \"awesome\": true}">>, []). +#{<<"awesome">> => true,<<"library">> => <<"jsx">>} +2> jsx:decode(<<"{\"library\": \"jsx\", \"awesome\": true}">>, [{return_maps, false}]). +[{<<"library">>,<<"jsx">>},{<<"awesome">>,true}] +3> jsx:decode(<<"[\"a\",\"list\",\"of\",\"words\"]">>). +[<<"a">>, <<"list">>, <<"of">>, <<"words">>] +``` + +#### to convert an erlang term into a utf8 binary containing a json string #### + +```erlang +1> jsx:encode(#{<<"library">> => <<"jsx">>, <<"awesome">> => true}). +<<"{\"awesome\":true,\"library\":\"jsx\"}">> +2> jsx:encode([{<<"library">>,<<"jsx">>},{<<"awesome">>,true}]). +<<"{\"library\": \"jsx\", \"awesome\": true}">> +3> jsx:encode([<<"a">>, <<"list">>, <<"of">>, <<"words">>]). +<<"[\"a\",\"list\",\"of\",\"words\"]">> +``` + +#### to check if a binary or a term is valid json #### + +```erlang +1> jsx:is_json(<<"[\"this is json\"]">>). +true +2> jsx:is_json("[\"this is not\"]"). +false +3> jsx:is_term([<<"this is a term">>]). +true +4> jsx:is_term([this, is, not]). +false +``` + +#### to minify some json #### + +```erlang +1> jsx:minify(<<"{ + \"a list\": [ + 1, + 2, + 3 + ] +}">>). +<<"{\"a list\":[1,2,3]}">> +``` + +#### to prettify some json #### + +```erlang +1> jsx:prettify(<<"{\"a list\":[1,2,3]}">>). +<<"{ + \"a list\": [ + 1, + 2, + 3 + ] +}">> +``` + +## description ## + + +**jsx** is an erlang application for consuming, producing and manipulating +[json][json] + +**jsx** follows the json [spec][rfc4627] as closely as possible with allowances for +real world usage + +**jsx** is pragmatic. the json spec allows extensions so **jsx** extends the spec in a +number of ways. see the section on `strict` in [options](#option) below though + +json has no official comments but this parser allows c/c++ style comments. +anywhere whitespace is allowed you can insert comments (both `// ...` and `/* ... */`) + +some particularly irresponsible json emitters leave trailing commas at the end of +objects or arrays. **jsx** allows a single trailing comma in input. multiple commas +in any posistion or a preceding comma are still errors + +all **jsx** decoder input should be `utf8` encoded binaries. sometimes you get binaries +that are almost but not quite valid utf8 whether due to improper escaping or poor +encoding. **jsx** replaces invalid codepoints and poorly formed sequences with the +unicode replacement character (`u+FFFD`) but does it's best to return something +comprehensible + +json only allows keys and strings to be delimited by double quotes (`u+0022`) but +javascript allows them to be delimited by single quotes (`u+0027`) as well. **jsx** +follows javascript in this. strings that start with single quotes can contain double +quotes but must end with single quotes and must escape any single quotes they contain + +json and **jsx** only recognize escape sequences as outlined in the json spec. it just +ignores bad escape sequences leaving them in strings unaltered + +### json <-> erlang mapping ### + +**json** | **erlang** +--------------------------------|-------------------------------- +`number` | `integer()` and `float()` +`string` | `binary()` and `atom()` +`true`, `false` and `null` | `true`, `false` and `null` +`array` | `[]` and `[JSON]` +`object` | `#{}`, `[{}]` and `[{binary() OR atom() OR integer(), JSON}]` +see below | `datetime()` + +* numbers + + javascript and thus json represent all numeric values with floats. there's no + reason for erlang -- a language that supports arbitrarily large integers -- to + restrict all numbers to the ieee754 range + + whenever possible, **jsx** will interpret json numbers that look like integers as + integers. other numbers will be converted to erlang's floating point type, which + is nearly but not quite iee754. negative zero is not representable in erlang (zero + is unsigned in erlang and `0` is equivalent to `-0`) and will be interpreted as + regular zero. numbers not representable are beyond the concern of this implementation, + and will result in parsing errors + + when converting from erlang to json, floats are represented with their + shortest representation that will round trip without loss of precision. this + means that some floats may be superficially dissimilar (although + functionally equivalent). for example, `1.0000000000000001` will be + represented by `1.0` + +* strings + + json strings must be unicode encoded binaries or erlang atoms. in practice, + because **jsx** only accepts `utf8` binaries all binary strings must be `utf8`. + in addition to being unicode json strings restrict a number of codepoints and + define a number of escape sequences + + json string escapes of the form `\uXXXX` will be converted to their + equivalent codepoints during parsing. this means control characters and + other codepoints disallowed by the json spec may be encountered in resulting + strings. the utf8 restriction means the surrogates are explicitly disallowed. + if a string contains escaped surrogates (`u+d800` to `u+dfff`) they are + interpreted but only when they form valid surrogate pairs. surrogates + encountered otherwise are replaced with the replacement codepoint (`u+fffd`) + + all erlang strings are represented by **valid** `utf8` encoded binaries. the + encoder will check strings for conformance. badly formed `utf8` sequences may + be replaced with the replacement codepoint (`u+fffd`) according to the unicode + spec + + this implementation performs no normalization on strings beyond that + detailed here. be careful when comparing strings as equivalent strings + may have different `utf8` encodings + +* true, false and null + + the json primitives `true`, `false` and `null` are represented by the + erlang atoms `true`, `false` and `null`. surprise + +* arrays + + json arrays are represented with erlang lists of json values as described + in this section + +* objects + + json objects are represented by erlang maps. + +* datetime + + erlang datetime tuples (`{{Year, Month, Day}, {Hour, Min, Sec}}`) as returned + from `erlang:localtime/0` are automatically encoded as [iso8601][iso8601] + strings and are assumed to be UTC time. no conversion is attempted of json [iso8601][iso8601] strings in decoded json + + +### incomplete input ### + +**jsx** can handle incomplete json texts. if the option `stream` is passed to the decoder +or parser and if a partial json text is parsed, rather than returning a term from +your callback handler, **jsx** returns `{incomplete, F}` where `F` is a function with +an identical API to the anonymous fun returned from `decoder/3`, `encoder/3` or +`parser/3`. it retains the internal state of the parser at the point where input +was exhausted. this allows you to parse as you stream json over a socket or file +descriptor, or to parse large json texts without needing to keep them entirely in +memory + +however, it is important to recognize that **jsx** is conservative by default. **jsx** will +not consider the parsing complete even when input is exhausted and the json text is +unambiguously incomplete. to end parsing call the `incomplete` function with the +argument `end_stream` (or `end_json`) like: + +```erlang +1> {incomplete, F} = jsx:decode(<<"[">>, [stream]). +{incomplete,#Fun} +2> F(end_stream). % can also be `F(end_json)` +** exception error: bad argument +3> {incomplete, G} = F(<<"]">>). +{incomplete,#Fun} +4> G(end_stream). % can also be `G(end_json)` +[] +``` + + +## data types ## + +#### `json_term()` #### + +```erlang +json_term() = [json_term()] + | [{binary() | atom() | integer(), json_term()}] + | #{} % map of any size, not just the empty map + | true + | false + | null + | integer() + | float() + | binary() + | atom() + | datetime() +``` + +the erlang representation of json. binaries should be `utf8` encoded, or close +at least + +#### `json_text()` #### + +```erlang +json_text() = binary() +``` + +a utf8 encoded binary containing a json string + +#### `event()` #### + +```erlang +event() = start_object + | end_object + | start_array + | end_array + | {key, binary()} + | {string, binary()} + | {integer, integer()} + | {float, float()} + | {literal, true} + | {literal, false} + | {literal, null} + | end_json +``` + +the subset of [`token()`](#token) emitted by the decoder and encoder to handlers + +#### `option()` #### + +```erlang +option() = dirty_strings + | escaped_forward_slashes + | escaped_strings + | repeat_keys + | stream + | strict + | {strict, [strict_option()]} + | return_tail + | uescape + | unescaped_jsonp + +strict_option() = comments + | trailing_commas + | utf8 + | single_quotes + | escapes +``` + +**jsx** functions all take a common set of options. not all flags have meaning +in all contexts, but they are always valid options. functions may have +additional options beyond these. see +[individual function documentation](#exports) for details + +- `dirty_strings` + + json escaping is lossy; it mutates the json string and repeated application + can result in unwanted behaviour. if your strings are already escaped (or + you'd like to force invalid strings into "json" you monster) use this flag + to bypass escaping. this can also be used to read in **really** invalid json + strings. everything between unescaped quotes are passed as is to the resulting + string term. note that this takes precedence over any other options + +- `escaped_forward_slashes` + + json strings are escaped according to the json spec. this means forward + slashes (solidus) are only escaped when this flag is present. otherwise they + are left unescaped. you may want to use this if you are embedding json + directly into a html or xml document + +- `escaped_strings` + + by default both the encoder and decoder return strings as utf8 binaries + appropriate for use in erlang. escape sequences that were present in decoded + terms are converted into the appropriate codepoint while encoded terms are + unaltered. this flag escapes strings as if for output in json, removing + control codes and problematic codepoints and replacing them with the + appropriate escapes + +- `stream` + + see [incomplete input](#incomplete-input) + +- `strict` + + as mentioned [earlier](#description), **jsx** is pragmatic. if you're more of a + json purist or you're really into bdsm stricter adherence to the spec is + possible. the following restrictions are available + + * `comments` + + comments are disabled and result in a `badarg` error + + * `trailing_commas` + + trailing commas in an object or list result in `badarg` errors + + * `utf8` + + invalid codepoints and malformed unicode result in `badarg` errors + + * `single_quotes` + + only keys and strings delimited by double quotes (`u+0022`) are allowed. the + single quote (`u+0027`) results in a `badarg` error + + * `escapes` + + escape sequences not adhering to the json spec result in a `badarg` error + + * `control_codes` + + control codes in strings result in `badarg` errors + + any combination of these can be passed to **jsx** by using `{strict, [strict_option()]}`. + `strict` is equivalent to `{strict, [comments, trailing_commas, utf8, single_quotes, escapes, control_codes]}` + +- `return_tail` + + upon reaching the end of a valid json term in an input stream return the term and any + remaining bytes in the input stream as `{with_tail, term(), binary()}` where the second + member of the tuple is the json term and the third is any remaining bytes. note that + leading whitespace will be stripped from the tail + +- `uescape` + + escape all codepoints outside the ascii range for 7 bit clean output. note + this escaping takes place even if no other string escaping is requested (via + `escaped_strings`) + +- `unescaped_jsonp` + + javascript interpreters treat the codepoints `u+2028` and `u+2029` as + significant whitespace. json strings that contain either of these codepoints + will be parsed incorrectly by some javascript interpreters. by default, + these codepoints are escaped (to `\u2028` and `\u2029`, respectively) to + retain compatibility. this option simply removes that escaping + + +## exports ## + + +#### `encoder/3`, `decoder/3` & `parser/3` #### + +```erlang +decoder(Module, Args, Opts) -> Fun((JSONText) -> any()) +encoder(Module, Args, Opts) -> Fun((JSONTerm) -> any()) +parser(Module, Args, Opts) -> Fun((Tokens) -> any()) + + Module = atom() + Args = any() + Opts = [option()] + JSONText = json_text() + JSONTerm = json_term() + Tokens = event() | [event()] +``` + +**jsx** is a json compiler with interleaved tokenizing, syntactic analysis and +semantic analysis stages. included are two tokenizers; one that handles json +texts (`decoder/3`) and one that handles erlang terms (`encoder/3`). there is +also an entry point to the syntactic analysis stage for use with user-defined +tokenizers (`parser/3`) + +all three functions return an anonymous function that takes the appropriate type +of input and returns the result of performing semantic analysis, the tuple +`{incomplete, F}` where `F` is a new anonymous function (see +[incomplete input](#incomplete_input)) or a `badarg` error exception if +syntactic analysis fails + +`Module` is the name of the callback module + +`Args` is any term that will be passed to `Module:init/1` prior to syntactic +analysis to produce an initial state + +`Opts` are detailed [here](#option) + +check out [callback module documentation](#callback_exports) for details of +the callback module interface + +#### `decode/1,2` #### + +```erlang +decode(JSON) -> Term +decode(JSON, Opts) -> Term + + JSON = json_text() + Term = json_term() + Opts = [option() | labels | {labels, Label} | return_maps] + Label = binary | atom | existing_atom | attempt_atom + F = fun((any()) -> any()) +``` + +`decode` parses a json text (a `utf8` encoded binary) and produces an erlang +term + +the option `labels` controls how keys are converted from json to +erlang terms. `binary` (the default behavior) does no conversion +beyond normal escaping. `atom` converts keys to erlang atoms and +results in a `badarg` error if the keys fall outside the range of erlang +atoms. `existing_atom` is identical to `atom` except it will not add +new atoms to the atom table and will result in a `badarg` error if the atom +does not exist. `attempt_atom` will convert keys to atoms when they exist, +and leave them as binary otherwise + +the option `{return_maps, false}` will return objects as proplists instead +of maps. + +raises a `badarg` error exception if input is not valid json + + +#### `encode/1,2` #### + +```erlang +encode(Term) -> JSON +encode(Term, Opts) -> JSON + + Term = json_term() + JSON = json_text() + Opts = [option() | space | {space, N} | indent | {indent, N}] + N = pos_integer() +``` + +`encode` converts an erlang term into json text (a `utf8` encoded binary) + +the option `{space, N}` inserts `N` spaces after every comma and colon in your +json output. `space` is an alias for `{space, 1}`. the default is `{space, 0}` + +the option `{indent, N}` inserts a newline and `N` spaces for each level of +indentation in your json output. note that this overrides spaces inserted after +a comma. `indent` is an alias for `{indent, 1}`. the default is `{indent, 0}` + +raises a `badarg` error exception if input is not a valid +[erlang representation of json](#json---erlang-mapping) + + +#### `format/1,2` #### + +```erlang +format(JSON) -> JSON +format(JSON, Opts) -> JSON + + JSON = json_text() + Opts = [option() | space | {space, N} | indent | {indent, N} | {newline, LF}] + N = pos_integer() + LF = binary() +``` + +`format` parses a json text (a `utf8` encoded binary) and produces a new json +text according to the format rules specified by `Opts` + +the option `{space, N}` inserts `N` spaces after every comma and colon in your +json output. `space` is an alias for `{space, 1}`. the default is `{space, 0}` + +the option `{indent, N}` inserts a newline and `N` spaces for each level of +indentation in your json output. note that this overrides spaces inserted after +a comma. `indent` is an alias for `{indent, 1}`. the default is `{indent, 0}` + +the option `{newline, LF}` defines a custom newline symbol(s). +the default is `{newline, <<$\n>>}` + +raises a `badarg` error exception if input is not valid json + + +#### `minify/1` #### + +```erlang +minify(JSON) -> JSON + + JSON = json_text() +``` + +`minify` parses a json text (a `utf8` encoded binary) and produces a new json +text stripped of whitespace + +raises a `badarg` error exception if input is not valid json + + +#### `prettify/1` #### + +```erlang +prettify(JSON) -> JSON + + JSON = json_text() +``` + +`prettify` parses a json text (a `utf8` encoded binary) and produces a new json +text equivalent to `format(JSON, [{space, 1}, {indent, 2}])` + +raises a `badarg` error exception if input is not valid json + + +#### `is_json/1,2` #### + +```erlang +is_json(MaybeJSON) -> true | false +is_json(MaybeJSON, Opts) -> true | false + + MaybeJSON = any() + Opts = options() +``` + +returns true if input is a valid json text, false if not + +what exactly constitutes valid json may be [altered](#option) + + +#### `is_term/1,2` #### + +```erlang +is_term(MaybeJSON) -> true | false +is_term(MaybeJSON, Opts) -> true | false + + MaybeJSON = any() + Opts = options() +``` + +returns true if input is a valid erlang representation of json, false if not + +what exactly constitutes valid json may be altered via [options](#option) + +## callback exports ## + +the following functions should be exported from a **jsx** callback module + +#### `Module:init/1` #### + +```erlang +Module:init(Args) -> InitialState + + Args = any() + InitialState = any() +``` + +whenever any of `encoder/3`, `decoder/3` or `parser/3` are called, this function +is called with the `Args` argument provided in the calling function to obtain +`InitialState` + +#### `Module:handle_event/2` #### + +```erlang +Module:handle_event(Event, State) -> NewState + + Event = [event()] + State = any() + NewState = any() +``` + +semantic analysis is performed by repeatedly calling `handle_event/2` with a +stream of events emitted by the tokenizer and the current state. the new state +returned is used as the input to the next call to `handle_event/2`. the +following events must be handled: + +- `start_object` + + the start of a json object + +- '{key, binary()}' + + the key of an entry in a json object + +- `end_object` + + the end of a json object + +- `start_array` + + the start of a json array + +- `end_array` + + the end of a json array + +- `{string, binary()}` + + a json string. it will usually be a `utf8` encoded binary. see the + [options](#option) for possible exceptions. note that keys are also + json strings + +- `{integer, integer()}` + + an erlang integer (bignum) + +- `{float, float()}` + + an erlang float + +- `{literal, true}` + + the atom `true` + +- `{literal, false}` + + the atom `false` + +- `{literal, null}` + + the atom `null` + +- `end_json` + + this event is emitted when syntactic analysis is completed. you should + do any cleanup and return the result of your semantic analysis + + +## acknowledgements ## + +jsx wouldn't be what it is without the contributions of [Paul J. Davis](https://github.com/davisp), [Lloyd Hilaiel](https://github.com/lloyd), [John Engelhart](https://github.com/johnezang), [Bob Ippolito](https://github.com/etrepum), [Brujo Benavides](https://github.com/elbrujohalcon), [Alex Kropivny](https://github.com/amtal), [Steve Strong](https://github.com/srstrong), [Michael Truog](https://github.com/okeuday), [Devin Torres](https://github.com/devinus), [fogfish](https://github.com/fogfish), [emptytea](https://github.com/emptytea), [John Daily](https://github.com/macintux), [Ola Bäckström](https://github.com/olabackstrom), [Joseph Crowe](https://github.com/JosephCrowe), [Patrick Gombert](https://github.com/patrickgombert), [Eshengazin S. Kuat](https://github.com/eskuat), [Max Lapshin](https://github.com/maxlapshin), [Bikram Chatterjee](https://github.com/c-bik), [Michael Uvarov](https://github.com/arcusfelis), [Led](https://github.com/Ledest) and [tvv](https://github.com/tvv) + +[json]: http://json.org +[yajl]: http://lloyd.github.com/yajl +[MIT]: http://www.opensource.org/licenses/mit-license.html +[rebar3]: https://rebar3.org +[meck]: https://github.com/eproxus/meck +[rfc4627]: http://tools.ietf.org/html/rfc4627 +[travis]: https://travis-ci.org/ +[jsxn]: https://github.com/talentdeficit/jsxn +[iso8601]: http://www.iso.org/iso/iso8601 diff --git a/server/_build/default/lib/jsx/ebin/jsx.app b/server/_build/default/lib/jsx/ebin/jsx.app new file mode 100644 index 0000000..24927b2 --- /dev/null +++ b/server/_build/default/lib/jsx/ebin/jsx.app @@ -0,0 +1,10 @@ +{application,jsx, + [{description,"a streaming, evented json parsing toolkit"}, + {vsn,"3.1.0"}, + {modules,[jsx,jsx_config,jsx_consult,jsx_decoder,jsx_encoder, + jsx_parser,jsx_to_json,jsx_to_term,jsx_verify]}, + {registered,[]}, + {applications,[kernel,stdlib]}, + {env,[]}, + {licenses,["MIT"]}, + {links,[{"Github","https://github.com/talentdeficit/jsx"}]}]}. diff --git a/server/_build/default/lib/jsx/ebin/jsx.beam b/server/_build/default/lib/jsx/ebin/jsx.beam new file mode 100644 index 0000000..adefbd0 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_config.beam b/server/_build/default/lib/jsx/ebin/jsx_config.beam new file mode 100644 index 0000000..b5b2c50 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_config.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_consult.beam b/server/_build/default/lib/jsx/ebin/jsx_consult.beam new file mode 100644 index 0000000..24d4164 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_consult.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_decoder.beam b/server/_build/default/lib/jsx/ebin/jsx_decoder.beam new file mode 100644 index 0000000..6df0019 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_decoder.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_encoder.beam b/server/_build/default/lib/jsx/ebin/jsx_encoder.beam new file mode 100644 index 0000000..65676e2 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_encoder.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_parser.beam b/server/_build/default/lib/jsx/ebin/jsx_parser.beam new file mode 100644 index 0000000..ee47da6 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_parser.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_to_json.beam b/server/_build/default/lib/jsx/ebin/jsx_to_json.beam new file mode 100644 index 0000000..ca9781a Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_to_json.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_to_term.beam b/server/_build/default/lib/jsx/ebin/jsx_to_term.beam new file mode 100644 index 0000000..25f3ef4 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_to_term.beam differ diff --git a/server/_build/default/lib/jsx/ebin/jsx_verify.beam b/server/_build/default/lib/jsx/ebin/jsx_verify.beam new file mode 100644 index 0000000..9da1cf2 Binary files /dev/null and b/server/_build/default/lib/jsx/ebin/jsx_verify.beam differ diff --git a/server/_build/default/lib/jsx/hex_metadata.config b/server/_build/default/lib/jsx/hex_metadata.config new file mode 100644 index 0000000..63f6e66 --- /dev/null +++ b/server/_build/default/lib/jsx/hex_metadata.config @@ -0,0 +1,15 @@ +{<<"app">>,<<"jsx">>}. +{<<"build_tools">>,[<<"rebar3">>]}. +{<<"description">>,<<"a streaming, evented json parsing toolkit">>}. +{<<"files">>, + [<<"LICENSE">>,<<"README.md">>,<<"rebar.config">>,<<"rebar.lock">>, + <<"src/jsx.app.src">>,<<"src/jsx.erl">>,<<"src/jsx_config.erl">>, + <<"src/jsx_config.hrl">>,<<"src/jsx_consult.erl">>, + <<"src/jsx_decoder.erl">>,<<"src/jsx_encoder.erl">>, + <<"src/jsx_parser.erl">>,<<"src/jsx_to_json.erl">>, + <<"src/jsx_to_term.erl">>,<<"src/jsx_verify.erl">>]}. +{<<"licenses">>,[<<"MIT">>]}. +{<<"links">>,[{<<"Github">>,<<"https://github.com/talentdeficit/jsx">>}]}. +{<<"name">>,<<"jsx">>}. +{<<"requirements">>,[]}. +{<<"version">>,<<"3.1.0">>}. diff --git a/server/_build/default/lib/jsx/rebar.config b/server/_build/default/lib/jsx/rebar.config new file mode 100644 index 0000000..1c71a9c --- /dev/null +++ b/server/_build/default/lib/jsx/rebar.config @@ -0,0 +1,17 @@ +{edoc_opts, [{preprocess, true}]}. +{erl_opts, [debug_info]}. +{dialyzer, [ + {warnings, [ + unknown, + unmatched_returns, + error_handling, + underspecs + ]} +]}. +{profiles, [ + {test, [ + {dialyzer, [ + {plt_extra_apps, [eunit]} + ]} + ]} +]}. diff --git a/server/_build/default/lib/jsx/rebar.lock b/server/_build/default/lib/jsx/rebar.lock new file mode 100644 index 0000000..57afcca --- /dev/null +++ b/server/_build/default/lib/jsx/rebar.lock @@ -0,0 +1 @@ +[]. diff --git a/server/_build/default/lib/jsx/src/jsx.app.src b/server/_build/default/lib/jsx/src/jsx.app.src new file mode 100644 index 0000000..0aff494 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx.app.src @@ -0,0 +1,10 @@ +{application,jsx, + [{description,"a streaming, evented json parsing toolkit"}, + {vsn,"3.1.0"}, + {modules,[jsx,jsx_encoder,jsx_decoder,jsx_parser,jsx_to_json, + jsx_to_term,jsx_config,jsx_verify]}, + {registered,[]}, + {applications,[kernel,stdlib]}, + {env,[]}, + {licenses,["MIT"]}, + {links,[{"Github","https://github.com/talentdeficit/jsx"}]}]}. diff --git a/server/_build/default/lib/jsx/src/jsx.erl b/server/_build/default/lib/jsx/src/jsx.erl new file mode 100644 index 0000000..d02d33b --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx.erl @@ -0,0 +1,506 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 alisdair sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx). + +-export([encode/1, encode/2, decode/1, decode/2]). +-export([is_json/1, is_json/2, is_term/1, is_term/2]). +-export([format/1, format/2, minify/1, prettify/1]). +-export([consult/1, consult/2]). +-export([encoder/3, decoder/3, parser/3]). +-export([resume/3]). + +-export_type([json_term/0, json_text/0, token/0]). +-export_type([encoder/0, decoder/0, parser/0, internal_state/0]). +-export_type([config/0]). + + +-ifdef(TEST). +%% data and helper functions for tests +-export([test_cases/0, special_test_cases/0]). +-export([init/1, handle_event/2]). +-endif. + +-type json_term() :: [{binary() | atom(), json_term()}] | [{},...] + | [json_term()] | [] + | {with_tail, json_term(), binary()} + | #{ binary() | atom() => json_term() } + | true | false | null + | integer() | float() + | binary() | atom() + | calendar:datetime(). + +-type json_text() :: binary(). + +-type config() :: jsx_config:config(). + +-spec encode(Source::json_term()) -> json_text() | {incomplete, encoder()}. + +encode(Source) -> encode(Source, []). + +-spec encode(Source::json_term(), Config::jsx_config:options()) -> json_text() | {incomplete, encoder()}. + +encode(Source, Config) -> jsx_to_json:to_json(Source, Config). + + +-spec decode(Source::json_text()) -> json_term() | {incomplete, decoder()}. + +decode(Source) -> decode(Source, []). + +-spec decode(Source::json_text(), Config::jsx_config:options()) -> json_term() | {incomplete, decoder()}. + +decode(Source, Config) -> jsx_to_term:to_term(Source, Config). + + +-spec format(Source::json_text()) -> json_text(). + +format(Source) -> format(Source, []). + +-spec format(Source::json_text(), Config::jsx_config:options()) -> json_text(). + +format(Source, Config) -> jsx_to_json:format(Source, Config). + + +-spec minify(Source::json_text()) -> json_text(). + +minify(Source) -> format(Source, []). + + +-spec prettify(Source::json_text()) -> json_text(). + +prettify(Source) -> format(Source, [space, {indent, 2}]). + + +-spec is_json(Source::binary()) -> boolean() | {incomplete, decoder()}. + +is_json(Source) -> is_json(Source, []). + +-spec is_json(Source::binary(), Config::jsx_config:options()) -> boolean() | {incomplete, decoder()}. + +is_json(Source, Config) -> jsx_verify:is_json(Source, Config). + + +-spec is_term(Source::json_term() | end_stream | end_json) -> boolean() | {incomplete, encoder()}. + +is_term(Source) -> is_term(Source, []). + +-spec is_term(Source::json_term() | end_stream | end_json, + Config::jsx_config:options()) -> boolean() | {incomplete, encoder()}. + +is_term(Source, Config) -> jsx_verify:is_term(Source, Config). + + +-spec consult(File::file:name_all()) -> list(jsx_consult:json_value()). + +consult(File) -> consult(File, []). + +-spec consult(File::file:name_all(), Config::jsx_consult:config()) -> list(jsx_consult:json_value()). + +consult(File, Config) -> jsx_consult:consult(File, Config). + + +-type decoder() :: fun((json_text() | end_stream | end_json) -> any()). + +-spec decoder(Handler::module(), State::any(), Config::jsx_config:options()) -> decoder(). + +decoder(Handler, State, Config) -> jsx_decoder:decoder(Handler, State, Config). + + +-type encoder() :: fun((json_term() | end_stream | end_json) -> any()). + +-spec encoder(Handler::module(), State::any(), Config::jsx_config:options()) -> encoder(). + +encoder(Handler, State, Config) -> jsx_encoder:encoder(Handler, State, Config). + + +-type token() :: [token()] + | start_object + | end_object + | start_array + | end_array + | {key, binary()} + | {string, binary()} + | binary() + | {number, integer() | float()} + | {integer, integer()} + | {float, float()} + | integer() + | float() + | {literal, true} + | {literal, false} + | {literal, null} + | true + | false + | null + | end_json. + + +-type parser() :: fun((token() | end_stream) -> any()). + +-spec parser(Handler::module(), State::any(), Config::jsx_config:options()) -> parser(). + +parser(Handler, State, Config) -> jsx_parser:parser(Handler, State, Config). + +-opaque internal_state() :: tuple(). + +-spec resume(Term::json_text() | token(), InternalState::internal_state(), + Config::jsx_config:options()) -> jsx:decoder() | {incomplete, jsx:decoder()}. + +resume(Term, {decoder, State, Handler, Acc, Stack}, Config) -> + jsx_decoder:resume(Term, State, Handler, Acc, Stack, jsx_config:parse_config(Config)); +resume(Term, {parser, State, Handler, Stack}, Config) -> + jsx_parser:resume(Term, State, Handler, Stack, jsx_config:parse_config(Config)). + +-ifdef(TEST). + +-include_lib("eunit/include/eunit.hrl"). + + +%% test handler +init([]) -> []. + +handle_event(end_json, State) -> lists:reverse([end_json] ++ State); +handle_event(Event, State) -> [Event] ++ State. + + +test_cases() -> + empty_array() + ++ nested_array() + ++ empty_object() + ++ nested_object() + ++ strings() + ++ literals() + ++ integers() + ++ floats() + ++ compound_object(). + +%% segregate these so we can skip them in `jsx_to_term` +special_test_cases() -> special_objects() ++ special_array(). + + +empty_array() -> [{"[]", <<"[]">>, [], [start_array, end_array]}]. + + +nested_array() -> + [{ + "[[[]]]", + <<"[[[]]]">>, + [[[]]], + [start_array, start_array, start_array, end_array, end_array, end_array] + }]. + + +empty_object() -> [{"{}", <<"{}">>, [{}], [start_object, end_object]}]. + + +nested_object() -> + [{ + "{\"key\":{\"key\":{}}}", + <<"{\"key\":{\"key\":{}}}">>, + [{<<"key">>, [{<<"key">>, [{}]}]}], + [ + start_object, + {key, <<"key">>}, + start_object, + {key, <<"key">>}, + start_object, + end_object, + end_object, + end_object + ] + }]. + + +naked_strings() -> + Raw = [ + "", + "hello world" + ], + [ + { + String, + <<"\"", (list_to_binary(String))/binary, "\"">>, + list_to_binary(String), + [{string, list_to_binary(String)}] + } + || String <- Raw + ]. + + +strings() -> + naked_strings() + ++ [ wrap_with_array(Test) || Test <- naked_strings() ] + ++ [ wrap_with_object(Test) || Test <- naked_strings() ]. + + +naked_integers() -> + Raw = [ + 1, 2, 3, + 127, 128, 129, + 255, 256, 257, + 65534, 65535, 65536, + 18446744073709551616, + 18446744073709551617 + ], + [ + { + integer_to_list(X), + list_to_binary(integer_to_list(X)), + X, + [{integer, X}] + } + || X <- Raw ++ [ -1 * Y || Y <- Raw ] ++ [0] + ]. + + +integers() -> + naked_integers() + ++ [ wrap_with_array(Test) || Test <- naked_integers() ] + ++ [ wrap_with_object(Test) || Test <- naked_integers() ]. + + +naked_floats() -> + Raw = [ + 0.0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, + 1.0, 1.1, 1.2, 1.3, 1.4, 1.5, 1.6, 1.7, 1.8, 1.9, + 1234567890.0987654321, + 0.0e0, + 1234567890.0987654321e16, + 0.1e0, 0.1e1, 0.1e2, 0.1e4, 0.1e8, 0.1e16, 0.1e308, + 1.0e0, 1.0e1, 1.0e2, 1.0e4, 1.0e8, 1.0e16, 1.0e308, + 2.2250738585072014e-308, %% min normalized float + 1.7976931348623157e308, %% max normalized float + 5.0e-324, %% min denormalized float + 2.225073858507201e-308 %% max denormalized float + ], + [ + { + sane_float_to_list(X), + list_to_binary(sane_float_to_list(X)), + X, + [{float, X}] + } + || X <- Raw ++ [ -1 * Y || Y <- Raw ] + ]. + + +floats() -> + naked_floats() + ++ [ wrap_with_array(Test) || Test <- naked_floats() ] + ++ [ wrap_with_object(Test) || Test <- naked_floats() ]. + + +naked_literals() -> + [ + { + atom_to_list(Literal), + atom_to_binary(Literal, unicode), + Literal, + [{literal, Literal}] + } + || Literal <- [true, false, null] + ]. + + +literals() -> + naked_literals() + ++ [ wrap_with_array(Test) || Test <- naked_literals() ] + ++ [ wrap_with_object(Test) || Test <- naked_literals() ]. + + +compound_object() -> + [{ + "[{\"alpha\":[1,2,3],\"beta\":{\"alpha\":[1.0,2.0,3.0],\"beta\":[true,false]}},[{}]]", + <<"[{\"alpha\":[1,2,3],\"beta\":{\"alpha\":[1.0,2.0,3.0],\"beta\":[true,false]}},[{}]]">>, + [[{<<"alpha">>, [1, 2, 3]}, {<<"beta">>, [{<<"alpha">>, [1.0, 2.0, 3.0]}, {<<"beta">>, [true, false]}]}], [[{}]]], + [ + start_array, + start_object, + {key, <<"alpha">>}, + start_array, + {integer, 1}, + {integer, 2}, + {integer, 3}, + end_array, + {key, <<"beta">>}, + start_object, + {key, <<"alpha">>}, + start_array, + {float, 1.0}, + {float, 2.0}, + {float, 3.0}, + end_array, + {key, <<"beta">>}, + start_array, + {literal, true}, + {literal, false}, + end_array, + end_object, + end_object, + start_array, + start_object, + end_object, + end_array, + end_array + ] + }]. + + +special_objects() -> + [ + { + "[{key, atom}]", + <<"{\"key\":\"atom\"}">>, + [{key, atom}], + [start_object, {key, <<"key">>}, {string, <<"atom">>}, end_object] + }, + { + "[{1, true}]", + <<"{\"1\":true}">>, + [{1, true}], + [start_object, {key, <<"1">>}, {literal, true}, end_object] + } + ]. + + +special_array() -> + [ + { + "[foo, bar]", + <<"[\"foo\",\"bar\"]">>, + [foo, bar], + [start_array, {string, <<"foo">>}, {string, <<"bar">>}, end_array] + } + ]. + + +wrap_with_array({Title, JSON, Term, Events}) -> + { + "[" ++ Title ++ "]", + <<"[", JSON/binary, "]">>, + [Term], + [start_array] ++ Events ++ [end_array] + }. + + +wrap_with_object({Title, JSON, Term, Events}) -> + { + "{\"key\":" ++ Title ++ "}", + <<"{\"key\":", JSON/binary, "}">>, + [{<<"key">>, Term}], + [start_object, {key, <<"key">>}] ++ Events ++ [end_object] + }. + + +sane_float_to_list(X) -> + [Output] = io_lib:format("~p", [X]), + Output. + + +incremental_decode(JSON) -> + Final = lists:foldl( + fun(Byte, Decoder) -> {incomplete, F} = Decoder(Byte), F end, + decoder(jsx, [], [stream]), + json_to_bytes(JSON) + ), + Final(end_stream). + + +incremental_parse(Events) -> + Final = lists:foldl( + fun(Event, Parser) -> {incomplete, F} = Parser(Event), F end, + parser(?MODULE, [], [stream]), + lists:map(fun(X) -> [X] end, Events) + ), + Final(end_stream). + + +%% used to convert a json text into a list of codepoints to be incrementally +%% parsed +json_to_bytes(JSON) -> json_to_bytes(JSON, []). + +json_to_bytes(<<>>, Acc) -> [<<>>] ++ lists:reverse(Acc); +json_to_bytes(<>, Acc) -> json_to_bytes(Rest, [<>] ++ Acc). + + +%% actual tests! +decode_test_() -> + Data = test_cases(), + [{Title, ?_assertEqual(Events ++ [end_json], (decoder(?MODULE, [], []))(JSON))} + || {Title, JSON, _, Events} <- Data + ] ++ + [{Title ++ " (incremental)", ?_assertEqual(Events ++ [end_json], incremental_decode(JSON))} + || {Title, JSON, _, Events} <- Data + ]. + + +parse_test_() -> + Data = test_cases(), + [{Title, ?_assertEqual(Events ++ [end_json], (parser(?MODULE, [], []))(Events ++ [end_json]))} + || {Title, _, _, Events} <- Data + ] ++ + [{Title ++ " (incremental)", ?_assertEqual(Events ++ [end_json], incremental_parse(Events))} + || {Title, _, _, Events} <- Data + ]. + + +encode_test_() -> + Data = test_cases(), + [ + { + Title, ?_assertEqual( + Events ++ [end_json], + (jsx:encoder(jsx, [], []))(Term) + ) + } || {Title, _, Term, Events} <- Data + ]. + +end_stream_test_() -> + Tokens = [start_object, end_object, end_json], + [ + {"encoder end_stream", ?_assertEqual( + Tokens, + begin + {incomplete, F} = (jsx:parser(jsx, [], [stream]))([start_object, end_object]), + F(end_stream) + end + )}, + {"encoder end_json", ?_assertEqual( + Tokens, + begin + {incomplete, F} = (jsx:parser(jsx, [], [stream]))([start_object, end_object]), + F(end_json) + end + )}, + {"decoder end_stream", ?_assertEqual( + Tokens, + begin {incomplete, F} = (jsx:decoder(jsx, [], [stream]))(<<"{}">>), F(end_stream) end + )}, + {"decoder end_json", ?_assertEqual( + Tokens, + begin {incomplete, F} = (jsx:decoder(jsx, [], [stream]))(<<"{}">>), F(end_json) end + )} + ]. + + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_config.erl b/server/_build/default/lib/jsx/src/jsx_config.erl new file mode 100644 index 0000000..ba1d872 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_config.erl @@ -0,0 +1,393 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 alisdair sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_config). + +-export([parse_config/1]). +-export([config_to_list/1]). +-export([extract_config/1, valid_flags/0]). + +-ifdef(TEST). +-export([fake_error_handler/3]). +-endif. + +-include("jsx_config.hrl"). + +-type handler_type(Handler) :: + fun((jsx:json_text() | end_stream | + jsx:json_term(), + {decoder, any(), module(), null | list(), list()} | + {parser, any(), module(), list()} | + {encoder, any(), module()}, + list({pre_encode, fun((any()) -> any())} | + {error_handler, Handler} | + {incomplete_handler, Handler} | + atom())) -> any()). +-type handler() :: handler_type(handler()). +-export_type([handler/0]). + +-type config() :: #config{}. +-export_type([config/0]). + +-type option() :: valid_flag() + | {valid_flag(), boolean()} + | {strict, [strict_option()]} + | {error_handler, fun((any(), any(), any()) -> ok)} + | {incomplete_handler, fun((any(), any(), any()) -> ok)} + | {return_maps, boolean()} + | {labels, label_option()} + | {space, non_neg_integer()} + | {indent, non_neg_integer()} + | {depth, non_neg_integer()} + | {newline, binary()} + | legacy_option() + | {legacy_option(), boolean()}. +-type legacy_option() :: strict_comments + | strict_commas + | strict_utf8 + | strict_single_quotes + | strict_escapes + | strict_control_codes. + +-type options() :: [option()]. +-export_type([options/0]). + +-type strict_option() :: comments + | trailing_commas + | utf8 + | single_quotes + | escapes + | control_codes. +-type label_option() :: binary + | atom + | existing_atom + | attempt_atom. + +-type valid_flag() :: escaped_forward_slashes + | escaped_strings + | unescaped_jsonp + | dirty_strings + | multi_term + | return_tail + | repeat_keys + | strict + | stream + | uescape + | error_handler + | incomplete_handler. + +%% parsing of jsx config +-spec parse_config(Config::options()) -> config(). + +parse_config(Config) -> parse_config(Config, #config{}). + +parse_config([], Config) -> Config; +parse_config([escaped_forward_slashes|Rest], Config) -> + parse_config(Rest, Config#config{escaped_forward_slashes=true}); +parse_config([escaped_strings|Rest], Config) -> + parse_config(Rest, Config#config{escaped_strings=true}); +parse_config([unescaped_jsonp|Rest], Config) -> + parse_config(Rest, Config#config{unescaped_jsonp=true}); +parse_config([dirty_strings|Rest], Config) -> + parse_config(Rest, Config#config{dirty_strings=true}); +parse_config([multi_term|Rest], Config) -> + parse_config(Rest, Config#config{multi_term=true}); +parse_config([return_tail|Rest], Config) -> + parse_config(Rest, Config#config{return_tail=true}); +%% retained for backwards compat, now does nothing however +parse_config([repeat_keys|Rest], Config) -> + parse_config(Rest, Config); +parse_config([uescape|Rest], Config) -> + parse_config(Rest, Config#config{uescape=true}); +parse_config([strict|Rest], Config) -> + parse_config(Rest, Config#config{ + strict_comments=true, + strict_commas=true, + strict_utf8=true, + strict_single_quotes=true, + strict_escapes=true, + strict_control_codes=true + }); +parse_config([{strict, Strict}|Rest], Config) -> + parse_strict(Strict, Rest, Config); +parse_config([stream|Rest], Config) -> + parse_config(Rest, Config#config{stream=true}); +parse_config([{error_handler, ErrorHandler}|Rest] = Options, Config) when is_function(ErrorHandler, 3) -> + case Config#config.error_handler of + false -> parse_config(Rest, Config#config{error_handler=ErrorHandler}) + ; _ -> erlang:error(badarg, [Options, Config]) + end; +parse_config([{incomplete_handler, IncompleteHandler}|Rest] = Options, Config) when is_function(IncompleteHandler, 3) -> + case Config#config.incomplete_handler of + false -> parse_config(Rest, Config#config{incomplete_handler=IncompleteHandler}) + ; _ -> erlang:error(badarg, [Options, Config]) + end; +parse_config(_Options, _Config) -> erlang:error(badarg). + + +parse_strict([], Rest, Config) -> parse_config(Rest, Config); +parse_strict([comments|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_comments=true}); +parse_strict([trailing_commas|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_commas=true}); +parse_strict([utf8|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_utf8=true}); +parse_strict([single_quotes|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_single_quotes=true}); +parse_strict([escapes|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_escapes=true}); +parse_strict([control_codes|Strict], Rest, Config) -> + parse_strict(Strict, Rest, Config#config{strict_control_codes=true}); +parse_strict(_Strict, _Rest, _Config) -> + erlang:error(badarg). + + + +-spec config_to_list(Config::config()) -> options(). + +config_to_list(Config) -> + reduce_config(lists:map( + fun ({error_handler, F}) -> {error_handler, F}; + ({incomplete_handler, F}) -> {incomplete_handler, F}; + ({Key, true}) -> Key + end, + lists:filter( + fun({_, false}) -> false; (_) -> true end, + lists:zip(record_info(fields, config), tl(tuple_to_list(Config))) + ) + )). + + +reduce_config(Input) -> reduce_config(Input, [], []). + +reduce_config([], Output, Strict) -> + case length(Strict) of + 0 -> lists:reverse(Output); + 5 -> lists:reverse(Output) ++ [strict]; + _ -> lists:reverse(Output) ++ [{strict, lists:reverse(Strict)}] + end; +reduce_config([strict_comments|Input], Output, Strict) -> + reduce_config(Input, Output, [comments] ++ Strict); +reduce_config([strict_utf8|Input], Output, Strict) -> + reduce_config(Input, Output, [utf8] ++ Strict); +reduce_config([strict_single_quotes|Input], Output, Strict) -> + reduce_config(Input, Output, [single_quotes] ++ Strict); +reduce_config([strict_escapes|Input], Output, Strict) -> + reduce_config(Input, Output, [escapes] ++ Strict); +reduce_config([strict_control_codes|Input], Output, Strict) -> + reduce_config(Input, Output, [control_codes] ++ Strict); +reduce_config([Else|Input], Output, Strict) -> + reduce_config(Input, [Else] ++ Output, Strict). + + +-spec valid_flags() -> [valid_flag(), ...]. + +valid_flags() -> + [ + escaped_forward_slashes, + escaped_strings, + unescaped_jsonp, + dirty_strings, + multi_term, + return_tail, + repeat_keys, + strict, + stream, + uescape, + error_handler, + incomplete_handler + ]. + + +-spec extract_config(Config::options()) -> options(). + +extract_config(Config) -> + extract_parser_config(Config, []). + +extract_parser_config([], Acc) -> Acc; +extract_parser_config([{K,V}|Rest], Acc) -> + case lists:member(K, valid_flags()) of + true -> extract_parser_config(Rest, [{K,V}] ++ Acc) + ; false -> extract_parser_config(Rest, Acc) + end; +extract_parser_config([K|Rest], Acc) -> + case lists:member(K, valid_flags()) of + true -> extract_parser_config(Rest, [K] ++ Acc) + ; false -> extract_parser_config(Rest, Acc) + end. + + +%% eunit tests +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +config_test_() -> + [ + {"all flags", + ?_assertEqual( + #config{escaped_forward_slashes = true, + escaped_strings = true, + unescaped_jsonp = true, + dirty_strings = true, + multi_term = true, + return_tail = true, + strict_comments = true, + strict_commas = true, + strict_utf8 = true, + strict_single_quotes = true, + strict_escapes = true, + strict_control_codes = true, + stream = true, + uescape = true + }, + parse_config([dirty_strings, + escaped_forward_slashes, + escaped_strings, + unescaped_jsonp, + multi_term, + return_tail, + repeat_keys, + strict, + stream, + uescape + ]) + ) + }, + {"strict flag", + ?_assertEqual( + #config{strict_comments = true, + strict_commas = true, + strict_utf8 = true, + strict_single_quotes = true, + strict_escapes = true, + strict_control_codes = true + }, + parse_config([strict]) + ) + }, + {"strict selective", + ?_assertEqual( + #config{strict_comments = true}, + parse_config([{strict, [comments]}]) + ) + }, + {"strict expanded", + ?_assertEqual( + #config{strict_comments = true, + strict_utf8 = true, + strict_single_quotes = true, + strict_escapes = true + }, + parse_config([{strict, [comments, utf8, single_quotes, escapes]}]) + ) + }, + {"error_handler flag", ?_assertEqual( + #config{error_handler=fun ?MODULE:fake_error_handler/3}, + parse_config([{error_handler, fun ?MODULE:fake_error_handler/3}]) + )}, + {"two error_handlers defined", ?_assertError( + badarg, + parse_config([ + {error_handler, fun(_, _, _) -> true end}, + {error_handler, fun(_, _, _) -> false end} + ]) + )}, + {"incomplete_handler flag", ?_assertEqual( + #config{incomplete_handler=fun ?MODULE:fake_error_handler/3}, + parse_config([{incomplete_handler, fun ?MODULE:fake_error_handler/3}]) + )}, + {"two incomplete_handlers defined", ?_assertError( + badarg, + parse_config([ + {incomplete_handler, fun(_, _, _) -> true end}, + {incomplete_handler, fun(_, _, _) -> false end} + ]) + )}, + {"bad option flag", ?_assertError(badarg, parse_config([this_flag_does_not_exist]))} + ]. + + +config_to_list_test_() -> + [ + {"empty config", ?_assertEqual( + [], + config_to_list(#config{}) + )}, + {"all flags", ?_assertEqual( + [dirty_strings, + escaped_forward_slashes, + escaped_strings, + multi_term, + stream, + uescape, + unescaped_jsonp, + strict + ], + config_to_list( + #config{escaped_forward_slashes = true, + escaped_strings = true, + unescaped_jsonp = true, + dirty_strings = true, + multi_term = true, + strict_comments = true, + strict_utf8 = true, + strict_single_quotes = true, + strict_escapes = true, + strict_control_codes = true, + stream = true, + uescape = true + } + ) + )}, + {"single strict", ?_assertEqual( + [{strict, [comments]}], + config_to_list(#config{strict_comments = true}) + )}, + {"multiple strict", ?_assertEqual( + [{strict, [utf8, single_quotes, escapes]}], + config_to_list(#config{strict_utf8 = true, strict_single_quotes = true, strict_escapes = true}) + )}, + {"all strict", ?_assertEqual( + [strict], + config_to_list(#config{strict_comments = true, + strict_utf8 = true, + strict_single_quotes = true, + strict_escapes = true, + strict_control_codes = true}) + )}, + {"error handler", ?_assertEqual( + [{error_handler, fun ?MODULE:fake_error_handler/3}], + config_to_list(#config{error_handler=fun ?MODULE:fake_error_handler/3}) + )}, + {"incomplete handler", ?_assertEqual( + [{incomplete_handler, fun ?MODULE:fake_error_handler/3}], + config_to_list(#config{incomplete_handler=fun ?MODULE:fake_error_handler/3}) + )} + ]. + + +fake_error_handler(_, _, _) -> ok. + + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_config.hrl b/server/_build/default/lib/jsx/src/jsx_config.hrl new file mode 100644 index 0000000..c89963c --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_config.hrl @@ -0,0 +1,18 @@ +-record(config, { + dirty_strings = false :: boolean(), + escaped_forward_slashes = false :: boolean(), + escaped_strings = false :: boolean(), + multi_term = false :: boolean(), + strict_comments = false :: boolean(), + strict_commas = false :: boolean(), + strict_utf8 = false :: boolean(), + strict_single_quotes = false :: boolean(), + strict_escapes = false :: boolean(), + strict_control_codes = false :: boolean(), + stream = false :: boolean(), + return_tail = false :: boolean(), + uescape = false :: boolean(), + unescaped_jsonp = false :: boolean(), + error_handler = false :: false | jsx_config:handler(), + incomplete_handler = false :: false | jsx_config:handler() +}). diff --git a/server/_build/default/lib/jsx/src/jsx_consult.erl b/server/_build/default/lib/jsx/src/jsx_consult.erl new file mode 100644 index 0000000..e0e73c9 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_consult.erl @@ -0,0 +1,81 @@ +%% The MIT License + +%% Copyright (c) 2010-2015 Alisdair Sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_consult). + +-export([consult/2]). +-export([init/1, reset/1, handle_event/2]). + + +-record(config, { + labels = binary, + return_maps = false +}). + +-type config() :: proplists:proplist(). +-export_type([config/0]). + +-type json_value() :: list(json_value()) + | map() + | true + | false + | null + | integer() + | float() + | binary(). +-export_type([json_value/0]). + +opts(Opts) -> [return_maps, multi_term] ++ Opts. + +-spec consult(File::file:name_all(), Config::config()) -> [json_value()]. + +consult(File, Config) when is_list(Config) -> + case file:read_file(File) of + {ok, Bin} -> + {Final, _, _} = (jsx:decoder( + ?MODULE, + opts(Config), + jsx_config:extract_config(opts(Config)) + ))(Bin), + lists:reverse(Final); + {error, _} -> erlang:error(badarg) + end. + + +-type state() :: {[], config(), {list(), #config{}}}. +-spec init(Config::config()) -> state(). + +init(Config) -> {[], Config, jsx_to_term:start_term(Config)}. + + +-spec reset(State::state()) -> state(). + +reset({Acc, Config, _}) -> {Acc, Config, jsx_to_term:start_term(Config)}. + + +-spec handle_event(Event::any(), State::state()) -> state(). + +handle_event(end_json, {Acc, Config, State}) -> + {[jsx_to_term:get_value(State)] ++ Acc, Config, State}; +handle_event(Event, {Acc, Config, State}) -> + {Acc, Config, jsx_to_term:handle_event(Event, State)}. diff --git a/server/_build/default/lib/jsx/src/jsx_decoder.erl b/server/_build/default/lib/jsx/src/jsx_decoder.erl new file mode 100644 index 0000000..a706c89 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_decoder.erl @@ -0,0 +1,1909 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 alisdair sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_decoder). + +%% inline handle_event, format_number and maybe_replace +-compile({inline, [handle_event/3]}). +-compile({inline, [format_number/1]}). +-compile({inline, [maybe_replace/2]}). +-compile({inline, [doublequote/5, singlequote/5]}). + +-export([decoder/3, resume/6]). + + +-spec decoder(Handler::module(), State::any(), Config::jsx_config:options()) -> jsx:decoder(). + +decoder(Handler, State, Config) -> + fun(JSON) -> start(JSON, {Handler, Handler:init(State)}, [], jsx_config:parse_config(Config)) end. + + +%% resume allows continuation from interrupted decoding without having to explicitly export +%% all states +-spec resume( + Rest::binary(), + State::atom(), + Handler::module(), + Acc::any(), + Stack::list(atom()), + Config::jsx:config() + ) -> jsx:decoder() | {incomplete, jsx:decoder()}. + +resume(Rest, State, Handler, Acc, Stack, Config) -> + case State of + start -> start(Rest, Handler, Stack, Config); + value -> value(Rest, Handler, Stack, Config); + object -> object(Rest, Handler, Stack, Config); + array -> array(Rest, Handler, Stack, Config); + colon -> colon(Rest, Handler, Stack, Config); + key -> key(Rest, Handler, Stack, Config); + string -> string(Rest, Handler, Acc, Stack, Config); + number -> number(Rest, Handler, Acc, Stack, Config); + true -> true(Rest, Handler, Stack, Config); + false -> false(Rest, Handler, Stack, Config); + null -> null(Rest, Handler, Stack, Config); + comment -> comment(Rest, Handler, Acc, Stack, Config); + maybe_done -> maybe_done(Rest, Handler, Stack, Config); + done -> done(Rest, Handler, Stack, Config) + end. + + +-include("jsx_config.hrl"). + + +%% whitespace +-define(space, 16#20). +-define(tab, 16#09). +-define(cr, 16#0D). +-define(newline, 16#0A). + +%% object delimiters +-define(start_object, 16#7B). +-define(end_object, 16#7D). + +%% array delimiters +-define(start_array, 16#5B). +-define(end_array, 16#5D). + +%% kv seperator +-define(comma, 16#2C). +-define(doublequote, 16#22). +-define(singlequote, 16#27). +-define(colon, 16#3A). + +%% string escape sequences +-define(rsolidus, 16#5C). +-define(solidus, 16#2F). + +%% math +-define(zero, 16#30). +-define(decimalpoint, 16#2E). +-define(negative, 16#2D). +-define(positive, 16#2B). + +%% comments +-define(star, 16#2A). + + +%% some useful guards +-define(is_hex(Symbol), + (Symbol >= $a andalso Symbol =< $f) orelse + (Symbol >= $A andalso Symbol =< $F) orelse + (Symbol >= $0 andalso Symbol =< $9) +). + +-define(is_nonzero(Symbol), + Symbol >= $1 andalso Symbol =< $9 +). + + +%% error is a macro so the stack trace shows the error site when possible +-ifndef(error). +-define(error(State, Bin, Handler, Acc, Stack, Config), + case Config#config.error_handler of + false -> erlang:error(badarg); + F -> F(Bin, {decoder, State, Handler, Acc, Stack}, jsx_config:config_to_list(Config)) + end +). +-define(error(State, Bin, Handler, Stack, Config), + ?error(State, Bin, Handler, null, Stack, Config) +). +-endif. + + +incomplete(State, Rest, Handler, Stack, Config = #config{stream=false}) -> + ?error(State, Rest, Handler, Stack, Config); +incomplete(State, Rest, Handler, Stack, Config) -> + incomplete(State, Rest, Handler, unused, Stack, Config). + + +incomplete(State, Rest, Handler, Acc, Stack, Config = #config{stream=false}) -> + ?error(State, Rest, Handler, Acc, Stack, Config); +incomplete(State, Rest, Handler, Acc, Stack, Config = #config{incomplete_handler=false}) -> + {incomplete, fun(Stream) when is_binary(Stream) -> + resume(<>, State, Handler, Acc, Stack, Config); + (End) when End == end_stream; End == end_json -> + case resume(<>, State, Handler, Acc, Stack, Config#config{stream=false}) of + {incomplete, _} -> ?error(State, Rest, Handler, Acc, Stack, Config); + Else -> Else + end + end + }; +incomplete(State, Rest, Handler, Acc, Stack, Config = #config{incomplete_handler=F}) -> + F(Rest, {decoder, State, Handler, Acc, Stack}, jsx_config:config_to_list(Config)). + + +handle_event(Event, {Handler, State}, _Config) -> {Handler, Handler:handle_event(Event, State)}. + + +start(<<16#ef, 16#bb, 16#bf, Rest/binary>>, Handler, Stack, Config) -> + value(Rest, Handler, Stack, Config); +start(<<16#ef, 16#bb>>, Handler, Stack, Config) -> + incomplete(start, <<16#ef, 16#bb>>, Handler, Stack, Config); +start(<<16#ef>>, Handler, Stack, Config) -> + incomplete(start, <<16#ef>>, Handler, Stack, Config); +start(<<>>, Handler, Stack, Config) -> + incomplete(start, <<>>, Handler, Stack, Config); +start(Bin, Handler, Stack, Config) -> + value(Bin, Handler, Stack, Config). + + +value(<>, Handler, Stack, Config) -> + string(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config) -> + value(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config) -> + object(Rest, handle_event(start_object, Handler, Config), [key|Stack], Config); +value(<>, Handler, Stack, Config) -> + array(Rest, handle_event(start_array, Handler, Config), [array|Stack], Config); +value(<<$t, $r, $u, $e, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, true}, Handler, Config), Stack, Config); +value(<<$f, $a, $l, $s, $e, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, false}, Handler, Config), Stack, Config); +value(<<$n, $u, $l, $l, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, null}, Handler, Config), Stack, Config); +value(<>, Handler, Stack, Config) -> + number(Rest, Handler, [?zero], [zero|Stack], Config); +value(<<$1, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$1], [integer|Stack], Config); +value(<<$2, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$2], [integer|Stack], Config); +value(<<$3, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$3], [integer|Stack], Config); +value(<<$4, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$4], [integer|Stack], Config); +value(<<$5, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$5], [integer|Stack], Config); +value(<<$6, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$6], [integer|Stack], Config); +value(<<$7, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$7], [integer|Stack], Config); +value(<<$8, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$8], [integer|Stack], Config); +value(<<$9, Rest/binary>>, Handler, Stack, Config) -> + number(Rest, Handler, [$9], [integer|Stack], Config); +value(<>, Handler, Stack, Config) -> + number(Rest, Handler, [$-], [negative|Stack], Config); +value(<>, Handler, Stack, Config) -> + value(Rest, Handler, Stack, Config); +value(<<$t, Rest/binary>>, Handler, Stack, Config) -> + true(Rest, Handler, Stack, Config); +value(<<$f, Rest/binary>>, Handler, Stack, Config) -> + false(Rest, Handler, Stack, Config); +value(<<$n, Rest/binary>>, Handler, Stack, Config) -> + null(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config) -> + value(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config) -> + value(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config=#config{strict_single_quotes=false}) -> + string(Rest, Handler, [singlequote|Stack], Config); +value(<> = Rest, Handler, Stack, Config=#config{strict_commas=false}) -> + maybe_done(Rest, Handler, Stack, Config); +value(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(value, <>, Handler, Stack, Config); +value(<>, Handler, Stack, Config) -> + comment(Rest, Handler, value, [comment|Stack], Config); +value(<>, Handler, Stack, Config) -> + comment(Rest, Handler, value, [multicomment|Stack], Config); +value(<>, Handler, Stack, Config) -> + incomplete(value, <>, Handler, Stack, Config); +value(<<>>, Handler, Stack, Config) -> + incomplete(value, <<>>, Handler, Stack, Config); +value(Bin, Handler, Stack, Config) -> + ?error(value, Bin, Handler, Stack, Config). + + +object(<>, Handler, Stack, Config) -> + string(Rest, Handler, Stack, Config); +object(<>, Handler, Stack, Config) -> + object(Rest, Handler, Stack, Config); +object(<>, Handler, [key|Stack], Config) -> + maybe_done(Rest, handle_event(end_object, Handler, Config), Stack, Config); +object(<>, Handler, Stack, Config) -> + object(Rest, Handler, Stack, Config); +object(<>, Handler, Stack, Config) -> + object(Rest, Handler, Stack, Config); +object(<>, Handler, Stack, Config) -> + object(Rest, Handler, Stack, Config); +object(<>, Handler, Stack, Config=#config{strict_single_quotes=false}) -> + string(Rest, Handler, [singlequote|Stack], Config); +object(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(object, <>, Handler, Stack, Config); +object(<>, Handler, Stack, Config) -> + comment(Rest, Handler, object, [comment|Stack], Config); +object(<>, Handler, Stack, Config) -> + comment(Rest, Handler, object, [multicomment|Stack], Config); +object(<>, Handler, Stack, Config) -> + incomplete(object, <>, Handler, Stack, Config); +object(<<>>, Handler, Stack, Config) -> + incomplete(object, <<>>, Handler, Stack, Config); +object(Bin, Handler, Stack, Config) -> + ?error(object, Bin, Handler, Stack, Config). + + +array(<>, Handler, [array|Stack], Config) -> + maybe_done(Rest, handle_event(end_array, Handler, Config), Stack, Config); +array(<>, Handler, Stack, Config) -> + array(Rest, Handler, Stack, Config); +array(<>, Handler, Stack, Config) -> + array(Rest, Handler, Stack, Config); +array(<>, Handler, Stack, Config) -> + array(Rest, Handler, Stack, Config); +array(<>, Handler, Stack, Config) -> + array(Rest, Handler, Stack, Config); +array(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + value(<>, Handler, Stack, Config); +array(<>, Handler, Stack, Config) -> + comment(Rest, Handler, array, [comment|Stack], Config); +array(<>, Handler, Stack, Config) -> + comment(Rest, Handler, array, [multicomment|Stack], Config); +array(<>, Handler, Stack, Config) -> + incomplete(array, <>, Handler, Stack, Config); +array(<<>>, Handler, Stack, Config) -> + incomplete(array, <<>>, Handler, Stack, Config); +array(Bin, Handler, Stack, Config) -> + value(Bin, Handler, Stack, Config). + + +colon(<>, Handler, [key|Stack], Config) -> + value(Rest, Handler, [object|Stack], Config); +colon(<>, Handler, Stack, Config) -> + colon(Rest, Handler, Stack, Config); +colon(<>, Handler, Stack, Config) -> + colon(Rest, Handler, Stack, Config); +colon(<>, Handler, Stack, Config) -> + colon(Rest, Handler, Stack, Config); +colon(<>, Handler, Stack, Config) -> + colon(Rest, Handler, Stack, Config); +colon(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(colon, <>, Handler, Stack, Config); +colon(<>, Handler, Stack, Config) -> + comment(Rest, Handler, colon, [comment|Stack], Config); +colon(<>, Handler, Stack, Config) -> + comment(Rest, Handler, colon, [multicomment|Stack], Config); +colon(<>, Handler, Stack, Config) -> + incomplete(colon, <>, Handler, Stack, Config); +colon(<<>>, Handler, Stack, Config) -> + incomplete(colon, <<>>, Handler, Stack, Config); +colon(Bin, Handler, Stack, Config) -> + ?error(colon, Bin, Handler, Stack, Config). + + +key(<>, Handler, Stack, Config) -> + string(Rest, Handler, Stack, Config); +key(<>, Handler, Stack, Config) -> + key(Rest, Handler, Stack, Config); +key(<>, Handler, [key|Stack], Config=#config{strict_commas=false}) -> + maybe_done(<>, Handler, [object|Stack], Config); +key(<>, Handler, Stack, Config) -> + key(Rest, Handler, Stack, Config); +key(<>, Handler, Stack, Config) -> + key(Rest, Handler, Stack, Config); +key(<>, Handler, Stack, Config) -> + key(Rest, Handler, Stack, Config); +key(<>, Handler, Stack, Config=#config{strict_single_quotes=false}) -> + string(Rest, Handler, [singlequote|Stack], Config); +key(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(key, <>, Handler, Stack, Config); +key(<>, Handler, Stack, Config) -> + comment(Rest, Handler, key, [comment|Stack], Config); +key(<>, Handler, Stack, Config) -> + comment(Rest, Handler, key, [multicomment|Stack], Config); +key(<>, Handler, Stack, Config) -> + incomplete(key, <>, Handler, Stack, Config); +key(<<>>, Handler, Stack, Config) -> + incomplete(key, <<>>, Handler, Stack, Config); +key(Bin, Handler, Stack, Config) -> + ?error(key, Bin, Handler, Stack, Config). + + +%% note that if you encounter an error from string and you can't find the clause that +%% caused it here, it might be in unescape below +string(Bin, Handler, Stack, Config) -> + string(Bin, Handler, [], Stack, Config). + + +string(<>, Handler, Acc, Stack, Config) -> + doublequote(Rest, Handler, Acc, Stack, Config); +string(<>, Handler, Acc, Stack, Config) -> + singlequote(Rest, Handler, Acc, Stack, Config); +string(<>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace(?solidus, Config)], Stack, Config); +string(<>, Handler, Acc, Stack, Config) -> + unescape(Rest, Handler, Acc, Stack, Config); +%% TODO this is pretty gross and i don't like it +string(<> = Bin, Handler, Acc, Stack, Config=#config{uescape=true}) -> + case X of + X when X < 16#80 -> count(Bin, Handler, Acc, Stack, Config); + X -> string(Rest, Handler, [Acc, json_escape_sequence(X)], Stack, Config) + end; +%% u+2028 +string(<<226, 128, 168, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace(16#2028, Config)], Stack, Config); +%% u+2029 +string(<<226, 128, 169, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace(16#2029, Config)], Stack, Config); +string(<> = Bin, Handler, Acc, Stack, Config=#config{strict_control_codes=true}) when X > 16#1f -> + count(Bin, Handler, Acc, Stack, Config); +string(<<_/utf8, _/binary>> = Bin, Handler, Acc, Stack, Config=#config{strict_control_codes=false}) -> + count(Bin, Handler, Acc, Stack, Config); +%% necessary for bytes that are badly formed utf8 that won't match in `count` +string(<>, Handler, Acc, Stack, Config=#config{dirty_strings=true}) -> + string(Rest, Handler, [Acc, X], Stack, Config); +%% u+fffe and u+ffff for R14BXX (subsequent runtimes will happily match with /utf8 +string(<<239, 191, 190, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, <<16#fffe/utf8>>], Stack, Config); +string(<<239, 191, 191, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, <<16#ffff/utf8>>], Stack, Config); +string(<<>>, Handler, Acc, Stack, Config) -> + incomplete(string, <<>>, Handler, Acc, Stack, Config); +string(<>, Handler, Acc, Stack, Config) when X >= 2#11000000 -> + incomplete(string, <>, Handler, Acc, Stack, Config); +string(<>, Handler, Acc, Stack, Config) when X >= 2#11100000, Y >= 2#10000000 -> + incomplete(string, <>, Handler, Acc, Stack, Config); +string(<>, Handler, Acc, Stack, Config) + when X >= 2#11100000, Y >= 2#10000000, Z >= 2#10000000 -> + incomplete(string, <>, Handler, Acc, Stack, Config); +%% surrogates +string(<<237, X, _, Rest/binary>>, Handler, Acc, Stack, Config=#config{strict_utf8=false}) + when X >= 160 -> + string(Rest, Handler, [Acc, <<16#fffd/utf8>>], Stack, Config); +%% overlong encodings and missing continuations of a 2 byte sequence +string(<>, Handler, Acc, Stack, Config=#config{strict_utf8=false}) + when X >= 192, X =< 223 -> + strip_continuations(Rest, Handler, Acc, Stack, Config, 1); +%% overlong encodings and missing continuations of a 3 byte sequence +string(<>, Handler, Acc, Stack, Config=#config{strict_utf8=false}) + when X >= 224, X =< 239 -> + strip_continuations(Rest, Handler, Acc, Stack, Config, 2); +%% overlong encodings and missing continuations of a 4 byte sequence +string(<>, Handler, Acc, Stack, Config=#config{strict_utf8=false}) + when X >= 240, X =< 247 -> + strip_continuations(Rest, Handler, Acc, Stack, Config, 3); +%% incompletes and unexpected bytes, including orphan continuations +string(<<_, Rest/binary>>, Handler, Acc, Stack, Config=#config{strict_utf8=false}) -> + string(Rest, Handler, [Acc, <<16#fffd/utf8>>], Stack, Config); +string(Bin, Handler, Acc, Stack, Config) -> ?error(string, Bin, Handler, Acc, Stack, Config). + + +count(Bin, Handler, Acc, Stack, Config) -> + Size = count(Bin, 0, Config), + <> = Bin, + string(Rest, Handler, [Acc, Clean], Stack, Config). + + +%% explicitly whitelist ascii set for faster parsing. really? really. someone should +%% submit a patch that unrolls simple guards +count(<<32, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<33, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<>, N, _) -> N; +count(<<35, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<36, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<37, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<38, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<>, N, _) -> N; +count(<<40, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<41, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<42, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<43, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<44, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<45, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<46, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<>, N, _) -> N; +count(<<48, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<49, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<50, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<51, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<52, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<53, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<54, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<55, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<56, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<57, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<58, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<59, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<60, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<61, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<62, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<63, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<64, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<65, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<66, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<67, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<68, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<69, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<70, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<71, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<72, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<73, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<74, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<75, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<76, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<77, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<78, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<79, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<80, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<81, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<82, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<83, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<84, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<85, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<86, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<87, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<88, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<89, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<90, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<91, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<>, N, _) -> N; +count(<<93, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<94, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<95, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<96, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<97, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<98, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<99, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<100, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<101, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<102, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<103, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<104, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<105, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<106, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<107, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<108, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<109, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<110, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<111, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<112, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<113, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<114, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<115, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<116, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<117, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<118, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<119, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<120, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<121, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<122, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<123, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<124, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<125, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<126, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<127, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<_, Rest/binary>>, N, Config=#config{dirty_strings=true}) -> + count(Rest, N + 1, Config); +count(<<_/utf8, _/binary>>, N, #config{uescape=true}) -> N; +count(<>, N, Config=#config{strict_control_codes=false}) when X < 32 -> + count(Rest, N + 1, Config); +count(<>, N, #config{strict_control_codes=true}) when X < 32 -> N; +count(<>, N, Config) -> + case X of + X when X < 16#800 -> count(Rest, N + 2, Config); + %% jsonp escaping + 16#2028 -> N; + 16#2029 -> N; + X when X < 16#10000 -> count(Rest, N + 3, Config); + _ -> count(Rest, N + 4, Config) + end; +count(_, N, _) -> N. + + +doublequote(Rest, Handler, Acc, [key|_] = Stack, Config) -> + colon(Rest, handle_event({key, iolist_to_binary(Acc)}, Handler, Config), Stack, Config); +doublequote(Rest, Handler, Acc, [singlequote|_] = Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace(?doublequote, Config)], Stack, Config); +doublequote(<<>>, Handler, Acc, [singlequote|_] = Stack, Config) -> + incomplete(string, <>, Handler, Acc, Stack, Config); +doublequote(Rest, Handler, Acc, Stack, Config) -> + maybe_done(Rest, handle_event({string, iolist_to_binary(Acc)}, Handler, Config), Stack, Config). + + +singlequote(Rest, Handler, Acc, [singlequote, key|Stack], Config) -> + colon(Rest, handle_event({key, iolist_to_binary(Acc)}, Handler, Config), [key|Stack], Config); +singlequote(Rest, Handler, Acc, [singlequote|Stack], Config) -> + maybe_done(Rest, handle_event({string, iolist_to_binary(Acc)}, Handler, Config), Stack, Config); +singlequote(Rest, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, ?singlequote], Stack, Config). + + +%% strips continuation bytes after bad utf bytes, guards against both too short +%% and overlong sequences. N is the maximum number of bytes to strip +strip_continuations(<>, Handler, Acc, Stack, Config, 0) -> + string(Rest, Handler, [Acc, <<16#fffd/utf8>>], Stack, Config); +strip_continuations(<>, Handler, Acc, Stack, Config, N) when X >= 128, X =< 191 -> + strip_continuations(Rest, Handler, Acc, Stack, Config, N - 1); +%% if end of input is reached before stripping the max number of continuations +%% possible magic numbers are reinserted into the stream that get us back to +%% the same state without complicated machinery +strip_continuations(<<>>, Handler, Acc, Stack, Config, N) -> + case N of + 1 -> incomplete(string, <<192>>, Handler, Acc, Stack, Config); + 2 -> incomplete(string, <<224>>, Handler, Acc, Stack, Config); + 3 -> incomplete(string, <<240>>, Handler, Acc, Stack, Config) + end; +%% not a continuation byte, insert a replacement character for sequence thus +%% far and dispatch back to string +strip_continuations(<>, Handler, Acc, Stack, Config, _) -> + string(Rest, Handler, [Acc, <<16#fffd/utf8>>], Stack, Config). + + +%% this all gets really gross and should probably eventually be folded into +%% but for now it fakes being part of string on incompletes and errors +unescape(<>, Handler, Acc, Stack, Config=#config{dirty_strings=true}) -> + string(<>, Handler, [Acc, <>], Stack, Config); +unescape(<>, Handler, Acc, Stack, Config=#config{dirty_strings=true}) -> + string(Rest, Handler, [Acc, <>], Stack, Config); +unescape(<<$b, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\b, Config)], Stack, Config); +unescape(<<$f, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\f, Config)], Stack, Config); +unescape(<<$n, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\n, Config)], Stack, Config); +unescape(<<$r, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\r, Config)], Stack, Config); +unescape(<<$t, Rest/binary>>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\t, Config)], Stack, Config); +unescape(<>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\", Config)], Stack, Config); +unescape(<>, Handler, Acc, Stack, Config=#config{strict_single_quotes=false}) -> + string(Rest, Handler, [Acc, <>], Stack, Config); +unescape(<>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($\\, Config)], Stack, Config); +unescape(<>, Handler, Acc, Stack, Config) -> + string(Rest, Handler, [Acc, maybe_replace($/, Config)], Stack, Config); +unescape(<<$u, F, A, B, C, ?rsolidus, $u, G, X, Y, Z, Rest/binary>>, Handler, Acc, Stack, Config) + when (A == $8 orelse A == $9 orelse A == $a orelse A == $b orelse A == $A orelse A == $B), + (X == $c orelse X == $d orelse X == $e orelse X == $f orelse X == $C orelse X == $D orelse X == $E orelse X == $F), + (F == $d orelse F == $D), + (G == $d orelse G == $D), + ?is_hex(B), ?is_hex(C), ?is_hex(Y), ?is_hex(Z) + -> + High = erlang:list_to_integer([$d, A, B, C], 16), + Low = erlang:list_to_integer([$d, X, Y, Z], 16), + Codepoint = (High - 16#d800) * 16#400 + (Low - 16#dc00) + 16#10000, + string(Rest, Handler, [Acc, <>], Stack, Config); +unescape(<<$u, F0, A, B, C, ?rsolidus, $u, W, X, Y, Z, Rest/binary>>, Handler, Acc, Stack, Config) + when (A == $8 orelse A == $9 orelse A == $a orelse A == $b orelse A == $A orelse A == $B), + (F0 == $d orelse F0 == $D), + ?is_hex(B), ?is_hex(C), ?is_hex(W), ?is_hex(X), ?is_hex(Y), ?is_hex(Z) + -> + case Config#config.strict_utf8 of + true -> ?error(string, <<$u, $d, A, B, C, ?rsolidus, $u, W, X, Y, Z, Rest/binary>>, Handler, Acc, Stack, Config); + false -> string(Rest, Handler, [Acc, <<16#fffd/utf8>>, <<16#fffd/utf8>>], Stack, Config) + end; +unescape(<<$u, F, A, B, C, ?rsolidus, Rest/binary>>, Handler, Acc, Stack, Config) + when (A == $8 orelse A == $9 orelse A == $a orelse A == $b orelse A == $A orelse A == $B), + (F == $d orelse F == $D), + ?is_hex(B), ?is_hex(C) + -> + incomplete(string, <>, Handler, Acc, Stack, Config); +unescape(<<$u, F, A, B, C>>, Handler, Acc, Stack, Config) + when (A == $8 orelse A == $9 orelse A == $a orelse A == $b orelse A == $A orelse A == $B), + (F == $d orelse F == $D), + ?is_hex(B), ?is_hex(C) + -> + incomplete(string, <>, Handler, Acc, Stack, Config); +unescape(<<$u, A, B, C, D, Rest/binary>>, Handler, Acc, Stack, Config) + when ?is_hex(A), ?is_hex(B), ?is_hex(C), ?is_hex(D) -> + case erlang:list_to_integer([A, B, C, D], 16) of + Codepoint when Codepoint < 16#d800; Codepoint > 16#dfff -> + string(Rest, Handler, [Acc, maybe_replace(Codepoint, Config)], Stack, Config); + _ when Config#config.strict_utf8 -> + ?error(string, <>, Handler, Acc, Stack, Config); + _ -> string(Rest, Handler, [Acc, <<16#fffd/utf8>>], Stack, Config) + end; +unescape(Bin, Handler, Acc, Stack, Config) -> + case is_partial_escape(Bin) of + true -> incomplete(string, <>, Handler, Acc, Stack, Config); + false -> case Config#config.strict_escapes of + true -> ?error(string, <>, Handler, Acc, Stack, Config); + false -> string(Bin, Handler, [Acc, <>], Stack, Config) + end + end. + + +is_partial_escape(<<$u, A, B, C>>) when ?is_hex(A), ?is_hex(B), ?is_hex(C) -> true; +is_partial_escape(<<$u, A, B>>) when ?is_hex(A), ?is_hex(B) -> true; +is_partial_escape(<<$u, A>>) when ?is_hex(A) -> true; +is_partial_escape(<<$u>>) -> true; +is_partial_escape(<<>>) -> true; +is_partial_escape(_) -> false. + + +maybe_replace(C, #config{dirty_strings=true}) -> <>; +maybe_replace($\b, #config{escaped_strings=true}) -> <<$\\, $b>>; +maybe_replace($\t, #config{escaped_strings=true}) -> <<$\\, $t>>; +maybe_replace($\n, #config{escaped_strings=true}) -> <<$\\, $n>>; +maybe_replace($\f, #config{escaped_strings=true}) -> <<$\\, $f>>; +maybe_replace($\r, #config{escaped_strings=true}) -> <<$\\, $r>>; +maybe_replace($\", #config{escaped_strings=true}) -> <<$\\, $\">>; +maybe_replace($/, Config=#config{escaped_strings=true}) -> + case Config#config.escaped_forward_slashes of + true -> <<$\\, $/>> + ; false -> <<$/>> + end; +maybe_replace($\\, #config{escaped_strings=true}) -> <<$\\, $\\>>; +maybe_replace(X, Config=#config{escaped_strings=true}) when X == 16#2028; X == 16#2029 -> + case Config#config.unescaped_jsonp of + true -> <> + ; false -> json_escape_sequence(X) + end; +maybe_replace(X, #config{escaped_strings=true}) when X < 32 -> + json_escape_sequence(X); +maybe_replace(X, _Config) -> <>. + + +%% convert a codepoint to it's \uXXXX equiv. +json_escape_sequence(X) when X < 65536 -> + <> = <>, + <<$\\, $u, (to_hex(A)), (to_hex(B)), (to_hex(C)), (to_hex(D))>>; +json_escape_sequence(X) -> + Adjusted = X - 16#10000, + <> = <>, + [json_escape_sequence(A + 16#d800), json_escape_sequence(B + 16#dc00)]. + + +%% ascii "1" is [49], "2" is [50], etc... +to_hex(10) -> $a; +to_hex(11) -> $b; +to_hex(12) -> $c; +to_hex(13) -> $d; +to_hex(14) -> $e; +to_hex(15) -> $f; +to_hex(X) -> X + 48. + + +number(<<$e, Rest/binary>>, Handler, Acc, [integer|Stack], Config) -> + number(Rest, Handler, [Acc, $., $0, $e], [e|Stack], Config); +number(<<$E, Rest/binary>>, Handler, Acc, [integer|Stack], Config) -> + number(Rest, Handler, [Acc, $., $0, $e], [e|Stack], Config); +number(<<$e, Rest/binary>>, Handler, Acc, [zero|Stack], Config) -> + number(Rest, Handler, [Acc, $., $0, $e], [e|Stack], Config); +number(<<$E, Rest/binary>>, Handler, Acc, [zero|Stack], Config) -> + number(Rest, Handler, [Acc, $., $0, $e], [e|Stack], Config); +number(<<>>, Handler, Acc, [State|Stack], Config=#config{stream=false}) -> + NumType = case State of + zero -> integer; + integer -> integer; + decimal -> float; + exp -> float + end, + finish_number(<<>>, Handler, {NumType, iolist_to_binary(Acc)}, Stack, Config); +number(<<>>, Handler, Acc, Stack, Config) -> + incomplete(number, <<>>, Handler, Acc, Stack, Config); +number(Bin, Handler, Acc, [State|Stack], Config) -> + Counted = case State of + zero -> zero(Bin, 0); + integer -> integer(Bin, 0); + negative -> negative(Bin, 0); + initialdecimal -> initialdecimal(Bin, 0); + decimal -> decimal(Bin, 0); + e -> e(Bin, 0); + ex -> ex(Bin, 0); + exp -> exp(Bin, 0) + end, + case Counted of + {finish_integer, Size} -> + <> = Bin, + finish_number(Rest, Handler, {integer, iolist_to_binary([Acc, Clean])}, Stack, Config); + {finish_float, Size} -> + <> = Bin, + finish_number(Rest, Handler, {float, iolist_to_binary([Acc, Clean])}, Stack, Config); + {error, Size} -> + <> = Bin, + ?error(number, Rest, Handler, [Acc, Clean], Stack, Config); + {NewState, Size} -> + <> = Bin, + number(Rest, Handler, [Acc, Clean], [NewState|Stack], Config) + end. + + +zero(<>, N) -> initialdecimal(Rest, N + 1); +zero(<<$e, _/binary>>, N) -> {integer, N}; +zero(<<$E, _/binary>>, N) -> {integer, N}; +zero(<<>>, N) -> {zero, N}; +zero(_, N) -> {finish_integer, N}. + + +integer(<<$0, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$1, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$2, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$3, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$4, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$5, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$6, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$7, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$8, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<<$9, Rest/binary>>, N) -> integer(Rest, N + 1); +integer(<>, N) -> initialdecimal(Rest, N + 1); +integer(<<$e, _/binary>>, N) -> {integer, N}; +integer(<<$E, _/binary>>, N) -> {integer, N}; +integer(<<>>, N) -> {integer, N}; +integer(_, N) -> {finish_integer, N}. + + +negative(<<$0, Rest/binary>>, N) -> zero(Rest, N + 1); +negative(<<$1, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$2, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$3, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$4, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$5, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$6, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$7, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$8, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<$9, Rest/binary>>, N) -> integer(Rest, N + 1); +negative(<<>>, N) -> {negative, N}; +negative(_, N) -> {error, N}. + + +initialdecimal(<<$0, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$1, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$2, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$3, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$4, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$5, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$6, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$7, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$8, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<$9, Rest/binary>>, N) -> decimal(Rest, N + 1); +initialdecimal(<<>>, N) -> {initialdecimal, N}; +initialdecimal(_, N) -> {error, N}. + + +decimal(<<$0, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$1, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$2, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$3, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$4, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$5, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$6, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$7, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$8, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$9, Rest/binary>>, N) -> decimal(Rest, N + 1); +decimal(<<$e, Rest/binary>>, N) -> e(Rest, N + 1); +decimal(<<$E, Rest/binary>>, N) -> e(Rest, N + 1); +decimal(<<>>, N) -> {decimal, N}; +decimal(_, N) -> {finish_float, N}. + + +e(<<$0, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$1, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$2, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$3, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$4, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$5, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$6, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$7, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$8, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<<$9, Rest/binary>>, N) -> exp(Rest, N + 1); +e(<>, N) -> ex(Rest, N + 1); +e(<>, N) -> ex(Rest, N + 1); +e(<<>>, N) -> {e, N}; +e(_, N) -> {error, N}. + + +ex(<<$0, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$1, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$2, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$3, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$4, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$5, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$6, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$7, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$8, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<$9, Rest/binary>>, N) -> exp(Rest, N + 1); +ex(<<>>, N) -> {ex, N}; +ex(_, N) -> {error, N}. + + +exp(<<$0, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$1, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$2, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$3, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$4, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$5, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$6, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$7, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$8, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<$9, Rest/binary>>, N) -> exp(Rest, N + 1); +exp(<<>>, N) -> {exp, N}; +exp(_, N) -> {finish_float, N}. + + +finish_number(Rest, Handler, Acc, Stack, Config) -> + maybe_done(Rest, handle_event(format_number(Acc), Handler, Config), Stack, Config). + +format_number({integer, Acc}) -> {integer, binary_to_integer(Acc)}; +format_number({float, Acc}) -> {float, binary_to_float(Acc)}. + +true(<<$r, $u, $e, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, true}, Handler, Config), Stack, Config); +true(<<$r, $u>>, Handler, Stack, Config) -> + incomplete(true, <<$r, $u>>, Handler, Stack, Config); +true(<<$r>>, Handler, Stack, Config) -> + incomplete(true, <<$r>>, Handler, Stack, Config); +true(<<>>, Handler, Stack, Config) -> + incomplete(true, <<>>, Handler, Stack, Config); +true(Bin, Handler, Stack, Config) -> + ?error(true, Bin, Handler, Stack, Config). + + +false(<<$a, $l, $s, $e, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, false}, Handler, Config), Stack, Config); +false(<<$a, $l, $s>>, Handler, Stack, Config) -> + incomplete(false, <<$a, $l, $s>>, Handler, Stack, Config); +false(<<$a, $l>>, Handler, Stack, Config) -> + incomplete(false, <<$a, $l>>, Handler, Stack, Config); +false(<<$a>>, Handler, Stack, Config) -> + incomplete(false, <<$a>>, Handler, Stack, Config); +false(<<>>, Handler, Stack, Config) -> + incomplete(false, <<>>, Handler, Stack, Config); +false(Bin, Handler, Stack, Config) -> + ?error(false, Bin, Handler, Stack, Config). + + +null(<<$u, $l, $l, Rest/binary>>, Handler, Stack, Config) -> + maybe_done(Rest, handle_event({literal, null}, Handler, Config), Stack, Config); +null(<<$u, $l>>, Handler, Stack, Config) -> + incomplete(null, <<$u, $l>>, Handler, Stack, Config); +null(<<$u>>, Handler, Stack, Config) -> + incomplete(null, <<$u>>, Handler, Stack, Config); +null(<<>>, Handler, Stack, Config) -> + incomplete(null, <<>>, Handler, Stack, Config); +null(Bin, Handler, Stack, Config) -> + ?error(null, Bin, Handler, Stack, Config). + + +comment(<>, Handler, Resume, [comment|Stack], Config) -> + resume(Rest, Resume, Handler, unused, Stack, Config); +comment(<>, Handler, Resume, Stack, Config) -> + comment(Rest, Handler, Resume, [multicomment|Stack], Config); +comment(<>, Handler, Resume, [multicomment|_] = Stack, Config) -> + incomplete(comment, <>, Handler, Resume, Stack, Config); +comment(<>, Handler, Resume, [multicomment|Stack], Config) -> + case Stack of + [multicomment|_] -> comment(Rest, Handler, Resume, Stack, Config); + _ -> resume(Rest, Resume, Handler, unused, Stack, Config) + end; +comment(<>, Handler, Resume, [multicomment|_] = Stack, Config) -> + incomplete(comment, <>, Handler, Resume, Stack, Config); +comment(<<_/utf8, Rest/binary>>, Handler, Resume, Stack, Config) -> + comment(Rest, Handler, Resume, Stack, Config); +comment(<<_, Rest/binary>>, Handler, Resume, Stack, Config=#config{strict_utf8=false}) -> + comment(Rest, Handler, Resume, Stack, Config); +comment(<<>>, Handler, done, [Comment], Config=#config{stream=false}) + when Comment == comment; Comment == multicomment -> + resume(<<>>, done, Handler, unused, [], Config); +comment(<<>>, Handler, Resume, Stack, Config) -> + incomplete(comment, <<>>, Handler, Resume, Stack, Config); +comment(Bin, Handler, Resume, Stack, Config) -> + ?error(comment, Bin, Handler, Resume, Stack, Config). + + +maybe_done(<>, Handler, [], Config) -> + done(Rest, handle_event(end_json, Handler, Config), [], Config); +maybe_done(<>, Handler, Stack, Config) -> + maybe_done(Rest, Handler, Stack, Config); +maybe_done(<>, Handler, [object|Stack], Config) -> + maybe_done(Rest, handle_event(end_object, Handler, Config), Stack, Config); +maybe_done(<>, Handler, [array|Stack], Config) -> + maybe_done(Rest, handle_event(end_array, Handler, Config), Stack, Config); +maybe_done(<>, Handler, [object|Stack], Config) -> + key(Rest, Handler, [key|Stack], Config); +maybe_done(<>, Handler, [array|_] = Stack, Config) -> + value(Rest, Handler, Stack, Config); +maybe_done(<>, Handler, Stack, Config) -> + maybe_done(Rest, Handler, Stack, Config); +maybe_done(<>, Handler, Stack, Config) -> + maybe_done(Rest, Handler, Stack, Config); +maybe_done(<>, Handler, Stack, Config) -> + maybe_done(Rest, Handler, Stack, Config); +maybe_done(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(maybe_done, <>, Handler, Stack, Config); +maybe_done(<>, Handler, Stack, Config) -> + comment(Rest, Handler, maybe_done, [comment|Stack], Config); +maybe_done(<>, Handler, Stack, Config) -> + comment(Rest, Handler, maybe_done, [multicomment|Stack], Config); +maybe_done(<>, Handler, Stack, Config) -> + incomplete(maybe_done, <>, Handler, Stack, Config); +maybe_done(<<>>, Handler, Stack, Config) when length(Stack) > 0 -> + incomplete(maybe_done, <<>>, Handler, Stack, Config); +maybe_done(Bin, Handler, Stack, Config) -> + ?error(maybe_done, Bin, Handler, Stack, Config). + + +done(<>, Handler, [], Config) -> + done(Rest, Handler, [], Config); +done(<>, Handler, [], Config) -> + done(Rest, Handler, [], Config); +done(<>, Handler, [], Config) -> + done(Rest, Handler, [], Config); +done(<>, Handler, [], Config) -> + done(Rest, Handler, [], Config); +done(<>, Handler, Stack, Config=#config{strict_comments=true}) -> + ?error(done, <>, Handler, Stack, Config); +done(<>, Handler, Stack, Config) -> + comment(Rest, Handler, done, [comment|Stack], Config); +done(<>, Handler, Stack, Config) -> + comment(Rest, Handler, done, [multicomment|Stack], Config); +done(<>, Handler, Stack, Config) -> + incomplete(done, <>, Handler, Stack, Config); +done(Bin, {_Handler, State}, _Stack, #config{return_tail=true}) -> + {with_tail,State, Bin}; +done(<<>>, {Handler, State}, [], Config=#config{stream=true}) -> + incomplete(done, <<>>, {Handler, State}, [], Config); +done(<<>>, {_Handler, State}, [], _Config) -> State; +done(Bin, {Handler, State}, _Stack, Config=#config{multi_term=true}) -> + value(Bin, {Handler, Handler:reset(State)}, [], Config); +done(Bin, Handler, Stack, Config) -> ?error(done, Bin, Handler, Stack, Config). + + + +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +json_to_bytes(JSON) -> json_to_bytes(JSON, []). + +json_to_bytes(<<>>, Acc) -> [<<>>] ++ lists:reverse(Acc); +json_to_bytes(<>, Acc) -> json_to_bytes(Rest, [<>] ++ Acc). + + +decode(JSON) -> decode(JSON, []). +decode(JSON, Config) -> (decoder(jsx, [], Config))(JSON). + + +incremental_decode(JSON) -> incremental_decode(JSON, []). +incremental_decode(JSON, Config) -> + Final = lists:foldl( + fun(Byte, Decoder) -> {incomplete, F} = Decoder(Byte), F end, + decoder(jsx, [], [stream] ++ Config), + json_to_bytes(JSON) + ), + Final(end_stream). + + +%% all these numbers have different representation in erlang than in javascript and +%% do not roundtrip like most integers/floats +special_number_test_() -> + Cases = [ + % {title, test form, json, opt flags} + {"-0", [{integer, 0}, end_json], <<"-0">>}, + {"-0.0", [{float, 0.0}, end_json], <<"-0.0">>}, + {"0e0", [{float, 0.0}, end_json], <<"0e0">>}, + {"0e4", [{float, 0.0}, end_json], <<"0e4">>}, + {"1e0", [{float, 1.0}, end_json], <<"1e0">>}, + {"-1e0", [{float, -1.0}, end_json], <<"-1e0">>}, + {"-0e0", [{float, -0.0}, end_json], <<"-0e0">>}, + {"1e4", [{float, 1.0e4}, end_json], <<"1e4">>}, + {"number terminated by whitespace", + [start_array, {integer, 1}, end_array, end_json], + <<"[ 1 ]">> + }, + {"number terminated by comma", + [start_array, {integer, 1}, {integer, 1}, end_array, end_json], + <<"[ 1, 1 ]">> + }, + {"number terminated by comma in object", + [start_object, {key, <<"x">>}, {integer, 1}, {key, <<"y">>}, {integer, 1}, end_object, end_json], + <<"{\"x\": 1, \"y\": 1}">> + } + ], + [{Title, ?_assertEqual(Events, decode(JSON))} + || {Title, Events, JSON} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertEqual(Events, incremental_decode(JSON))} + || {Title, Events, JSON} <- Cases + ]. + + +comments_test_() -> + Cases = [ + % {title, test form, json, opt flags} + {"preceeding // comment", + [start_array, end_array, end_json], + <<"// comment ", ?newline, "[]">> + }, + {"preceeding /**/ comment", + [start_array, end_array, end_json], + <<"/* comment */[]">> + }, + {"trailing // comment", + [start_array, end_array, end_json], + <<"[]// comment", ?newline>> + }, + {"trailing // comment (no newline)", + [start_array, end_array, end_json], + <<"[]// comment">> + }, + {"trailing /**/ comment", + [start_array, end_array, end_json], + <<"[] /* comment */">> + }, + {"// comment inside array", + [start_array, end_array, end_json], + <<"[ // comment", ?newline, "]">> + }, + {"/**/ comment inside array", + [start_array, end_array, end_json], + <<"[ /* comment */ ]">> + }, + {"// comment at beginning of array", + [start_array, {literal, true}, end_array, end_json], + <<"[ // comment", ?newline, "true", ?newline, "]">> + }, + {"/**/ comment at beginning of array", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* comment */ true ]">> + }, + {"// comment at end of array", + [start_array, {literal, true}, end_array, end_json], + <<"[ true // comment", ?newline, "]">> + }, + {"/**/ comment at end of array", + [start_array, {literal, true}, end_array, end_json], + <<"[ true /* comment */ ]">> + }, + {"// comment midarray (post comma)", + [start_array, {literal, true}, {literal, false}, end_array, end_json], + <<"[ true, // comment", ?newline, "false ]">> + }, + {"/**/ comment midarray (post comma)", + [start_array, {literal, true}, {literal, false}, end_array, end_json], + <<"[ true, /* comment */ false ]">> + }, + {"// comment midarray (pre comma)", + [start_array, {literal, true}, {literal, false}, end_array, end_json], + <<"[ true// comment", ?newline, ", false ]">> + }, + {"/**/ comment midarray (pre comma)", + [start_array, {literal, true}, {literal, false}, end_array, end_json], + <<"[ true/* comment */, false ]">> + }, + {"// comment inside object", + [start_object, end_object, end_json], + <<"{ // comment", ?newline, "}">> + }, + {"/**/ comment inside object", + [start_object, end_object, end_json], + <<"{ /* comment */ }">> + }, + {"// comment at beginning of object", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ // comment", ?newline, " \"key\": true", ?newline, "}">> + }, + {"/**/ comment at beginning of object", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ /* comment */ \"key\": true }">> + }, + {"// comment at end of object", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\": true // comment", ?newline, "}">> + }, + {"/**/ comment at end of object", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\": true /* comment */ }">> + }, + {"// comment midobject (post comma)", + [ + start_object, + {key, <<"x">>}, + {literal, true}, + {key, <<"y">>}, + {literal, false}, + end_object, + end_json + ], + <<"{ \"x\": true, // comment", ?newline, "\"y\": false }">> + }, + {"/**/ comment midobject (post comma)", + [ + start_object, + {key, <<"x">>}, + {literal, true}, + {key, <<"y">>}, + {literal, false}, + end_object, + end_json + ], + <<"{ \"x\": true, /* comment */", ?newline, "\"y\": false }">> + }, + {"// comment midobject (pre comma)", + [ + start_object, + {key, <<"x">>}, + {literal, true}, + {key, <<"y">>}, + {literal, false}, + end_object, + end_json + ], + <<"{ \"x\": true// comment", ?newline, ", \"y\": false }">> + }, + {"/**/ comment midobject (pre comma)", + [ + start_object, + {key, <<"x">>}, + {literal, true}, + {key, <<"y">>}, + {literal, false}, + end_object, + end_json + ], + <<"{ \"x\": true/* comment */", ?newline, ", \"y\": false }">> + }, + {"// comment precolon", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\" // comment", ?newline, ": true }">> + }, + {"/**/ comment precolon", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\"/* comment */: true }">> + }, + {"// comment postcolon", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\": // comment", ?newline, " true }">> + }, + {"/**/ comment postcolon", + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + <<"{ \"key\":/* comment */ true }">> + }, + {"// comment terminating zero", + [start_array, {integer, 0}, end_array, end_json], + <<"[ 0// comment", ?newline, "]">> + }, + {"// comment terminating integer", + [start_array, {integer, 1}, end_array, end_json], + <<"[ 1// comment", ?newline, "]">> + }, + {"// comment terminating float", + [start_array, {float, 1.0}, end_array, end_json], + <<"[ 1.0// comment", ?newline, "]">> + }, + {"// comment terminating exp", + [start_array, {float, 1.0e1}, end_array, end_json], + <<"[ 1e1// comment", ?newline, "]">> + }, + {"/**/ comment terminating zero", + [start_array, {integer, 0}, end_array, end_json], + <<"[ 0/* comment */ ]">> + }, + {"/**/ comment terminating integer", + [start_array, {integer, 1}, end_array, end_json], + <<"[ 1/* comment */ ]">> + }, + {"/**/ comment terminating float", + [start_array, {float, 1.0}, end_array, end_json], + <<"[ 1.0/* comment */ ]">> + }, + {"/**/ comment terminating exp", + [start_array, {float, 1.0e1}, end_array, end_json], + <<"[ 1e1/* comment */ ]">> + }, + {"/**/ comment following /**/ comment", + [start_array, {literal, true}, end_array, end_json], + <<"[/* comment *//* comment */true]">> + }, + {"/**/ comment following // comment", + [start_array, {literal, true}, end_array, end_json], + <<"[// comment", ?newline, "/* comment */true]">> + }, + {"// comment following /**/ comment", + [start_array, {literal, true}, end_array, end_json], + <<"[/* comment */// comment", ?newline, "true]">> + }, + {"// comment following // comment", + [start_array, {literal, true}, end_array, end_json], + <<"[// comment", ?newline, "// comment", ?newline, "true]">> + }, + {"/**/ comment inside /**/ comment", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* /* comment */ */ true ]">> + }, + {"/**/ comment with /", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* / */ true ]">> + }, + {"/**/ comment with *", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* * */ true ]">> + }, + {"// comment with badutf", + [start_array, {literal, true}, end_array, end_json], + <<"[ // comment ", 16#00c0, " ", ?newline, "true]">> + }, + {"/**/ comment with badutf", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* comment ", 16#00c0, " */ true]">> + }, + {"/**/ comment with badutf preceeded by /", + [start_array, {literal, true}, end_array, end_json], + <<"[ /* comment /", 16#00c0, " */ true]">> + } + ], + [{Title, ?_assertEqual(Events, decode(JSON))} + || {Title, Events, JSON} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertEqual(Events, incremental_decode(JSON))} + || {Title, Events, JSON} <- Cases + ] ++ + % error when `{strict, [comments]}` is present + [{Title, ?_assertError(badarg, decode(JSON, [{strict, [comments]}]))} + || {Title, _Events, JSON} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertError( + badarg, + incremental_decode(JSON, [{strict, [comments]}]) + )} || {Title, _Events, JSON} <- Cases + ]. + + +no_comments_test_() -> + Cases = [ + {"// comment with badutf", + badarg, + <<"[ // comment ", 16#00c0, " ", ?newline, "true]">>, + [{strict, [utf8]}] + }, + {"/**/ comment with badutf", + badarg, + <<"[ /* comment ", 16#00c0, " */ true]">>, + [{strict, [utf8]}] + }, + {"/**/ comment with badutf preceeded by /", + badarg, + <<"[ /* comment /", 16#00c0, " */ true]">>, + [{strict, [utf8]}] + } + ], + [{Title, ?_assertError(Error, decode(JSON, Config))} + || {Title, Error, JSON, Config} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertError(Error, incremental_decode(JSON, Config))} + || {Title, Error, JSON, Config} <- Cases + ]. + + +% doing the full unicode range takes foreverrrrrrr so just do boundaries +% excludes characters that may need escaping +codepoints() -> + lists:seq(0, 32) ++ + [32, 33] ++ + lists:seq(35, 46) ++ + lists:seq(48, 91) ++ + lists:seq(93, 127) ++ + [16#2027, 16#202a, 16#d7ff, 16#e000] ++ + lists:seq(16#fdd0, 16#ffff) ++ + [16#10000, 16#20000, 16#30000, 16#40000, 16#50000] ++ + [16#60000, 16#70000, 16#80000, 16#90000, 16#a0000, 16#b0000] ++ + [16#c0000, 16#d0000, 16#e0000, 16#f0000, 16#100000]. + + +surrogates() -> lists:seq(16#d800, 16#dfff). + + +%% erlang refuses to decode certain codepoints, so fake them all +to_fake_utf8(N) when N < 16#0080 -> <<34/utf8, N:8, 34/utf8>>; +to_fake_utf8(N) when N < 16#0800 -> + <<0:5, Y:5, X:6>> = <>, + <<34/utf8, 2#110:3, Y:5, 2#10:2, X:6, 34/utf8>>; +to_fake_utf8(N) when N < 16#10000 -> + <> = <>, + <<34/utf8, 2#1110:4, Z:4, 2#10:2, Y:6, 2#10:2, X:6, 34/utf8>>; +to_fake_utf8(N) -> + <<0:3, W:3, Z:6, Y:6, X:6>> = <>, + <<34/utf8, 2#11110:5, W:3, 2#10:2, Z:6, 2#10:2, Y:6, 2#10:2, X:6, 34/utf8>>. + + +clean_string_test_() -> + Clean = codepoints(), + Dirty = surrogates(), + % clean codepoints + [{"clean u+" ++ integer_to_list(Codepoint, 16), ?_assertEqual( + [{string, <>}, end_json], + decode(<<34/utf8, Codepoint/utf8, 34/utf8>>) + )} || Codepoint <- Clean + ] ++ + % bad codepoints replaced by u+FFFD + [{"clean u+" ++ integer_to_list(Codepoint, 16), ?_assertEqual( + [{string, <<16#fffd/utf8>>}, end_json], + decode(to_fake_utf8(Codepoint)) + )} || Codepoint <- Dirty + ] ++ + % bad codepoints that cause errors + [{"dirty u+" ++ integer_to_list(Codepoint, 16), ?_assertError( + badarg, + decode(to_fake_utf8(Codepoint), [{strict, [utf8]}]) + )} || Codepoint <- Dirty + ]. + + +dirty_string_test_() -> + Cases = [ + {"dirty \\n", + [start_array, {string, <<"\\n">>}, end_array, end_json], + <<"[\"\\n\"]">>, + [dirty_strings] + }, + {"dirty \\uwxyz", + [start_array, {string, <<"\\uwxyz">>}, end_array, end_json], + <<"[\"\\uwxyz\"]">>, + [dirty_strings] + }, + {"dirty \\x23", + [start_array, {string, <<"\\x23">>}, end_array, end_json], + <<"[\"\\x23\"]">>, + [dirty_strings] + }, + {"dirty 0", + [start_array, {string, <<0>>}, end_array, end_json], + <<"[\"", 0, "\"]">>, + [dirty_strings] + }, + {"dirty 0\\\"0", + [start_array, {string, <<0, ?rsolidus, ?doublequote, 0>>}, end_array, end_json], + <<"[\"", 0, ?rsolidus, ?doublequote, 0, "\"]">>, + [dirty_strings] + }, + {"dirty 0\\\\\"0", + [start_array, {string, <<0, ?rsolidus, ?rsolidus, ?doublequote, 0>>}, end_array, end_json], + <<"[\"", 0, ?rsolidus, ?rsolidus, ?doublequote, 0, "\"]">>, + [dirty_strings] + }, + {"dirty 16#d800", + [start_array, {string, <<237, 160, 128>>}, end_array, end_json], + <<"[\"", 237, 160, 128, "\"]">>, + [dirty_strings] + }, + {"dirty /", + [start_array, {string, <<$/>>}, end_array, end_json], + <<"[\"", $/, "\"]">>, + [dirty_strings, escaped_forward_slashes] + }, + {"dirty <<194, 129>>", + [start_array, {string, <<194, 129>>}, end_array, end_json], + <<"[\"", 194, 129, "\"]">>, + [dirty_strings] + } + ], + [{Title, ?_assertEqual(Events, decode(JSON, Config))} + || {Title, Events, JSON, Config} <- Cases + ] ++ + % ensure `dirty_strings` and `strict` interact properly + [{Title, ?_assertEqual(Events, decode(JSON, Config ++ [strict]))} + || {Title, Events, JSON, Config} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertEqual(Events, incremental_decode(JSON, Config))} + || {Title, Events, JSON, Config} <- Cases + ]. + + +bad_utf8_test_() -> + Cases = [ + {"orphan continuation byte u+0080", <<16#fffd/utf8>>, <<16#0080>>}, + {"orphan continuation byte u+00bf", <<16#fffd/utf8>>, <<16#00bf>>}, + {"2 continuation bytes", + binary:copy(<<16#fffd/utf8>>, 2), + <<(binary:copy(<<16#0080>>, 2))/binary>> + }, + {"3 continuation bytes", + binary:copy(<<16#fffd/utf8>>, 3), + <<(binary:copy(<<16#0080>>, 3))/binary>> + }, + {"4 continuation bytes", + binary:copy(<<16#fffd/utf8>>, 4), + <<(binary:copy(<<16#0080>>, 4))/binary>> + }, + {"5 continuation bytes", + binary:copy(<<16#fffd/utf8>>, 5), + <<(binary:copy(<<16#0080>>, 5))/binary>> + }, + {"6 continuation bytes", + binary:copy(<<16#fffd/utf8>>, 6), + <<(binary:copy(<<16#0080>>, 6))/binary>> + }, + {"all continuation bytes", + binary:copy(<<16#fffd/utf8>>, length(lists:seq(16#0080, 16#00bf))), + <<(list_to_binary(lists:seq(16#0080, 16#00bf)))/binary>> + }, + {"lonely start byte", <<16#fffd/utf8>>, <<16#00c0>>}, + {"lonely start bytes (2 byte)", + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + <<16#00c0, 32, 16#00df>> + }, + {"lonely start bytes (3 byte)", + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + <<16#00e0, 32, 16#00ef>> + }, + {"lonely start bytes (4 byte)", + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + <<16#00f0, 32, 16#00f7>> + }, + {"missing continuation byte (3 byte)", <<16#fffd/utf8, 32>>, <<224, 160, 32>>}, + {"missing continuation byte (4 byte missing one)", + <<16#fffd/utf8, 32>>, + <<240, 144, 128, 32>> + }, + {"missing continuation byte (4 byte missing two)", + <<16#fffd/utf8, 32>>, + <<240, 144, 32>> + }, + {"overlong encoding of u+002f (2 byte)", + <<16#fffd/utf8, 32>>, + <<16#c0, 16#af, 32>> + }, + {"overlong encoding of u+002f (3 byte)", + <<16#fffd/utf8, 32>>, + <<16#e0, 16#80, 16#af, 32>> + }, + {"overlong encoding of u+002f (4 byte)", + <<16#fffd/utf8, 32>>, + <<16#f0, 16#80, 16#80, 16#af, 32>> + }, + {"highest overlong 2 byte sequence", + <<16#fffd/utf8, 32>>, + <<16#c1, 16#bf, 32>> + }, + {"highest overlong 3 byte sequence", + <<16#fffd/utf8, 32>>, + <<16#e0, 16#9f, 16#bf, 32>> + }, + {"highest overlong 4 byte sequence", + <<16#fffd/utf8, 32>>, + <<16#f0, 16#8f, 16#bf, 16#bf, 32>> + } + ], + [{Title, ?_assertError( + badarg, + decode(<<34, JSON/binary, 34>>, [{strict, [utf8]}]) + )} || {Title, _, JSON} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertError( + badarg, + incremental_decode(<<34, JSON/binary, 34>>, [{strict, [utf8]}]) + )} || {Title, _, JSON} <- Cases + ] ++ + [{Title ++ " replaced", ?_assertEqual( + [{string, Replacement}, end_json], + decode(<<34, JSON/binary, 34>>) + )} || {Title, Replacement, JSON} <- Cases + ] ++ + [{Title ++ " replaced (incremental)", ?_assertEqual( + [{string, Replacement}, end_json], + incremental_decode(<<34, JSON/binary, 34>>) + )} || {Title, Replacement, JSON} <- Cases + ]. + + +unescape_test_() -> + Cases = [ + {"unescape backspace", <<"\b">>, <<"\\b"/utf8>>}, + {"unescape tab", <<"\t">>, <<"\\t"/utf8>>}, + {"unescape newline", <<"\n">>, <<"\\n"/utf8>>}, + {"unescape formfeed", <<"\f">>, <<"\\f"/utf8>>}, + {"unescape carriage return", <<"\r">>, <<"\\r"/utf8>>}, + {"unescape quote", <<"\"">>, <<"\\\""/utf8>>}, + {"unescape solidus", <<"/">>, <<"\\/"/utf8>>}, + {"unescape reverse solidus", <<"\\">>, <<"\\\\"/utf8>>}, + {"unescape control", <<0>>, <<"\\u0000"/utf8>>}, + {"unescape surrogate pair", <<16#10000/utf8>>, <<"\\ud800\\udc00"/utf8>>}, + {"unescape surrogate pair", <<16#10000/utf8>>, <<"\\uD800\\uDC00"/utf8>>}, + {"replace bad high surrogate", <<16#fffd/utf8>>, <<"\\udc00"/utf8>>}, + {"replace bad high surrogate", <<16#fffd/utf8>>, <<"\\uDC00"/utf8>>}, + {"replace naked high surrogate", + <<16#fffd/utf8, "hello world">>, + <<"\\ud800hello world"/utf8>> + }, + {"replace naked high surrogate", + <<16#fffd/utf8, "hello world">>, + <<"\\uD800hello world"/utf8>> + }, + {"replace naked low surrogate", + <<16#fffd/utf8, "hello world">>, + <<"\\udc00hello world"/utf8>> + }, + {"replace naked low surrogate", + <<16#fffd/utf8, "hello world">>, + <<"\\uDC00hello world"/utf8>> + }, + {"replace bad surrogate pair", <<16#fffd/utf8, 16#fffd/utf8>>, <<"\\ud800\\u0000">>}, + {"replace bad surrogate pair", <<16#fffd/utf8, 16#fffd/utf8>>, <<"\\uD800\\u0000">>} + ], + [{Title, ?_assertEqual([{string, Escaped}, end_json], decode(<<34, JSON/binary, 34>>))} + || {Title, Escaped, JSON} <- Cases + ] ++ + [{Title ++ " (incremental)", ?_assertEqual( + [{string, Escaped}, end_json], + incremental_decode(<<34, JSON/binary, 34>>) + )} || {Title, Escaped, JSON} <- Cases + ]. + + +bad_escaped_surrogate_test_() -> + Cases = [ + {"do not unescape bad high surrogate", <<"\\udc00">>}, + {"do not unescape naked high surrogate", <<"\\ud800hello world">>}, + {"do not unescape naked low surrogate", <<"\\udc00hello world">>}, + {"do not unescape bad surrogate pair", <<"\\ud800\\u0000">>} + ], + [{Title, ?_assertError(badarg, decode(<<34, JSON/binary, 34>>, [{strict, [utf8]}]))} + || {Title, JSON} <- Cases + ]. + + +escape_test_() -> + Cases = [ + {"backspace", <<"\b">>, <<"\\b">>}, + {"tab", <<"\t">>, <<"\\t">>}, + {"newline", <<"\n">>, <<"\\n">>}, + {"formfeed", <<"\f">>, <<"\\f">>}, + {"carriage return", <<"\r">>, <<"\\r">>}, + {"quote", <<"\"">>, <<"\\\"">>}, + {"backslash", <<"\\">>, <<"\\\\">>}, + {"control", <<0>>, <<"\\u0000">>} + ], + [{"escape " ++ Title, ?_assertEqual( + [{string, Escaped}, end_json], + decode(<<34, Escaped/binary, 34>>, [escaped_strings]) + )} || {Title, _Unescaped, Escaped} <- Cases + ] ++ + [{"do not escape " ++ Title, ?_assertEqual( + [{string, Unescaped}, end_json], + decode(<<34, Escaped/binary, 34>>) + )} || {Title, Unescaped, Escaped} <- Cases + ]. + + +special_escape_test_() -> + Cases = [ + {"escape forward slash", <<"\\/">>, <<"/"/utf8>>, [escaped_forward_slashes]}, + {"do not escape forward slash", <<"/">>, <<"/"/utf8>>, []}, + {"escape jsonp", <<"\\u2028">>, <<16#2028/utf8>>, []}, + {"do not escape jsonp", <<16#2028/utf8>>, <<16#2028/utf8>>, [unescaped_jsonp]} + ], + [{Title, ?_assertEqual( + [{string, Expect}, end_json], + decode(<<34, Raw/binary, 34>>, [escaped_strings] ++ Config) + )} || {Title, Expect, Raw, Config} <- Cases + ]. + + +uescape_test_() -> + [ + {"\"\\u0080\"", ?_assertEqual( + [{string, <<"\\u0080">>}, end_json], + decode(<<34, 128/utf8, 34>>, [uescape]) + )}, + {"\"\\u8ca8\\u5481\\u3002\\u0091\\u0091\"", ?_assertEqual( + [{string, <<"\\u8ca8\\u5481\\u3002\\u0091\\u0091">>}, end_json], + decode( + <<34,232,178,168,229,146,129,227,128,130,194,145,194,145,34>>, + [uescape] + ) + )}, + {"\"\\ud834\\udd1e\"", ?_assertEqual( + [{string, <<"\\ud834\\udd1e">>}, end_json], + decode(<<34, 240, 157, 132, 158, 34>>, [uescape]) + )}, + {"\"\\ud83d\\ude0a\"", ?_assertEqual( + [{string, <<"\\ud83d\\ude0a">>}, end_json], + decode(<<34, 240, 159, 152, 138, 34>>, [uescape]) + )} + ]. + + +single_quoted_string_test_() -> + Cases = [ + {"single quoted string", [{string, <<"hello world">>}, end_json], <<39, "hello world", 39>>}, + {"single quoted string with embedded double quotes", + [{string, <<"quoth the raven, \"nevermore\"">>}, end_json], + <<39, "quoth the raven, \"nevermore\"", 39>> + }, + {"escaped single quote", + [{string, <<"quoth the raven, 'nevermore'">>}, end_json], + <<39, "quoth the raven, \\'nevermore\\'", 39>> + }, + {"single quoted key", + [start_object, + {key, <<"key">>}, {string, <<"value">>}, + {key, <<"another key">>}, {string, <<"another value">>}, + end_object, end_json], + <<"{'key':'value','another key':'another value'}">> + } + ], + [{Title, ?_assertEqual(Expect, decode(Raw, []))} || {Title, Expect, Raw} <- Cases] ++ + [{Title, ?_assertError( + badarg, + decode(Raw, [{strict, [single_quotes]}]) + )} || {Title, _Expect, Raw} <- Cases + ]. + + +embedded_single_quoted_string_test_() -> + [ + {"string with embedded single quotes", ?_assertEqual( + [{string, <<"quoth the raven, 'nevermore'">>}, end_json], + decode(<<34, "quoth the raven, 'nevermore'", 34>>, []) + )}, + {"string with embedded single quotes", ?_assertEqual( + [{string, <<"quoth the raven, 'nevermore'">>}, end_json], + decode(<<34, "quoth the raven, 'nevermore'", 34>>, [{strict, [single_quotes]}]) + )} + ]. + + +ignored_bad_escapes_test_() -> + [ + {"ignore unrecognized escape sequence", ?_assertEqual( + [{string, <<"\\x25">>}, end_json], + decode(<<"\"\\x25\"">>, []) + )} + ]. + + +bom_test_() -> + [ + {"bom", ?_assertEqual( + [start_array, end_array, end_json], + decode(<<16#ef, 16#bb, 16#bf, "[]"/utf8>>, []) + )} + ]. + + +trailing_comma_test_() -> + [ + {"trailing comma in object", ?_assertEqual( + [start_object, {key, <<"key">>}, {literal, true}, end_object, end_json], + decode(<<"{\"key\": true,}">>, []) + )}, + {"strict trailing comma in object", ?_assertError( + badarg, + decode(<<"{\"key\": true,}">>, [{strict, [trailing_commas]}]) + )}, + {"two trailing commas in object", ?_assertError( + badarg, + decode(<<"{\"key\": true,,}">>, []) + )}, + {"comma in empty object", ?_assertError( + badarg, + decode(<<"{,}">>, []) + )}, + {"trailing comma in list", ?_assertEqual( + [start_array, {literal, true}, end_array, end_json], + decode(<<"[true,]">>, []) + )}, + {"strict trailing comma in list", ?_assertError( + badarg, + decode(<<"[true,]">>, [{strict, [trailing_commas]}]) + )}, + {"two trailing commas in list", ?_assertError( + badarg, + decode(<<"[true,,]">>, []) + )}, + {"comma in empty list", ?_assertError( + badarg, + decode(<<"[,]">>, []) + )} + ]. + + +incomplete_test_() -> + [ + {"stream false", ?_assertError( + badarg, + decode(<<"{">>) + )}, + {"stream true", ?_assertMatch( + {incomplete, _}, + decode(<<"{">>, [stream]) + )}, + {"complete input", ?_assertMatch( + {incomplete, _}, + decode(<<"{}">>, [stream]) + )} + ]. + + +error_test_() -> + Cases = [ + {"maybe_bom error", <<16#ef, 0>>}, + {"definitely_bom error", <<16#ef, 16#bb, 0>>}, + {"object error", <<"{"/utf8, 0>>}, + {"colon error", <<"{\"\""/utf8, 0>>}, + {"key error", <<"{\"\":1,"/utf8, 0>>}, + {"value error", <<0>>}, + {"negative error", <<"-"/utf8, 0>>}, + {"zero error", <<"0"/utf8, 0>>}, + {"integer error", <<"1"/utf8, 0>>}, + {"decimal error", <<"1.0"/utf8, 0>>}, + {"e error", <<"1e"/utf8, 0>>}, + {"ex error", <<"1e+"/utf8, 0>>}, + {"exp error", <<"1e1"/utf8, 0>>}, + {"exp error", <<"1.0e1"/utf8, 0>>}, + {"exp error", <<"1.e"/utf8>>}, + {"true error", <<"tru"/utf8, 0>>}, + {"false error", <<"fals"/utf8, 0>>}, + {"null error", <<"nul"/utf8, 0>>}, + {"maybe_done error", <<"[[]"/utf8, 0>>}, + {"done error", <<"[]"/utf8, 0>>} + ], + [{Title, ?_assertError(badarg, decode(State))} || {Title, State} <- Cases]. + + +custom_incomplete_handler_test_() -> + [ + {"custom incomplete handler", ?_assertError( + incomplete, + decode(<<>>, [{incomplete_handler, fun(_, _, _) -> erlang:error(incomplete) end}, stream]) + )} + ]. + + +return_tail_test_() -> + [ + {"return_tail with tail", ?_assertEqual( + {with_tail,#{},<<"3">>}, + jsx:decode(<<"{} 3">>, [return_tail]) + )}, + {"return_tail without tail", ?_assertEqual( + {with_tail,#{},<<"">>}, + jsx:decode(<<"{}">>, [return_tail]) + )}, + {"return_tail with trimmed whitespace", ?_assertEqual( + {with_tail,#{},<<"">>}, + jsx:decode(<<"{} ">>, [return_tail]) + )}, + {"return_tail and streaming", ?_assertEqual( + {with_tail,#{},<<"3">>}, + begin + {incomplete, F} = jsx:decode(<<"{">>, [return_tail, stream]), + F(<<"} 3">>) + end + )}, + {"return_tail and streaming", ?_assertEqual( + {with_tail,#{},<<"">>}, + begin + %% In case of infinite stream of objects a user does not know + %% when to call F(end_stream). + %% So, return_tail overwrites conservative stream end. + %% This means that we don't need to call end_stream explicitly. + {incomplete, F} = jsx:decode(<<"{">>, [return_tail, stream]), + F(<<"}">>) + end + )} + ]. + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_encoder.erl b/server/_build/default/lib/jsx/src/jsx_encoder.erl new file mode 100644 index 0000000..a1242a7 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_encoder.erl @@ -0,0 +1,116 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 Alisdair Sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_encoder). + +-export([encoder/3, encode/1, encode/2]). + +-spec encoder(Handler::module(), State::any(), Config::jsx_config:options()) -> jsx:encoder(). + +encoder(Handler, State, Config) -> + Parser = jsx:parser(Handler, State, Config), + fun(Term) -> Parser(encode(Term) ++ [end_json]) end. + + +-spec encode(Term::any()) -> [any(), ...]. + +encode(Term) -> encode(Term, ?MODULE). + + +-spec encode(Term::any(), EntryPoint::module()) -> [any(), ...]. + +encode(Map, _EntryPoint) when is_map(Map), map_size(Map) < 1 -> + [start_object, end_object]; +encode(Term, EntryPoint) when is_map(Term) -> + [start_object] ++ unpack(Term, EntryPoint); +encode(Term, EntryPoint) -> encode_(Term, EntryPoint). + +encode_([], _EntryPoint) -> [start_array, end_array]; +encode_([{}], _EntryPoint) -> [start_object, end_object]; + +%% datetime special case +encode_([{{_,_,_},{_,_,_}} = DateTime|Rest], EntryPoint) -> + [start_array] ++ [DateTime] ++ unhitch(Rest, EntryPoint); +encode_([{_, _}|_] = Term, EntryPoint) -> + [start_object] ++ unzip(Term, EntryPoint); +encode_(Term, EntryPoint) when is_list(Term) -> + [start_array] ++ unhitch(Term, EntryPoint); + +encode_(Else, _EntryPoint) -> [Else]. + + +unzip([{K, V}|Rest], EntryPoint) when is_integer(K); is_binary(K); is_atom(K) -> + [K] ++ EntryPoint:encode(V, EntryPoint) ++ unzip(Rest, EntryPoint); +unzip([], _) -> [end_object]; +unzip(_, _) -> erlang:error(badarg). + + +unhitch([V|Rest], EntryPoint) -> + EntryPoint:encode(V, EntryPoint) ++ unhitch(Rest, EntryPoint); +unhitch([], _) -> [end_array]. + +unpack(Map, EntryPoint) -> unpack(Map, maps:keys(Map), EntryPoint). + +unpack(Map, [K|Rest], EntryPoint) when is_integer(K); is_binary(K); is_atom(K) -> + [K] ++ EntryPoint:encode(maps:get(K, Map), EntryPoint) ++ unpack(Map, Rest, EntryPoint); +unpack(_, [], _) -> [end_object]. + +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +parser(Term, Opts) -> (jsx:parser(jsx, [], Opts))(Term). + + +error_test_() -> + [ + {"value error", ?_assertError(badarg, parser(self(), []))}, + {"string error", ?_assertError(badarg, parser(<<239, 191, 191>>, [strict]))} + ]. + +custom_error_handler_test_() -> + Error = fun(Term, {_, State, _, _}, _) -> {State, Term} end, + [ + {"value error", ?_assertEqual( + {value, [self()]}, + parser(self(), [{error_handler, Error}]) + )}, + {"string error", ?_assertEqual( + {value, [{string, <<237, 160, 128>>}]}, + parser(<<237, 160, 128>>, [{error_handler, Error}, strict]) + )} + ]. + +improper_lists_test_() -> + [ + {"improper proplist", ?_assertError( + badarg, + encode([{<<"key">>, <<"value">>}, false]) + )}, + {"improper list", ?_assertError( + badarg, + encode([{literal, true}, false, null]) + )} + ]. + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_parser.erl b/server/_build/default/lib/jsx/src/jsx_parser.erl new file mode 100644 index 0000000..8506b03 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_parser.erl @@ -0,0 +1,1214 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 Alisdair Sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_parser). + +-export([parser/3, resume/5]). +-export([init/1, handle_event/2]). + + +-spec parser(Handler::module(), State::any(), Config::jsx_config:options()) -> jsx:parser(). + +parser(Handler, State, Config) -> + fun(Tokens) -> value(Tokens, {Handler, Handler:init(State)}, [], jsx_config:parse_config(Config)) end. + + +%% resume allows continuation from interrupted decoding without having to explicitly export +%% all states +-spec resume( + Rest::jsx:token(), + State::atom(), + Handler::module(), + Stack::list(atom()), + Config::jsx:config() + ) -> jsx:parser() | {incomplete, jsx:parser()}. + +resume(Rest, State, Handler, Stack, Config) -> + case State of + value -> value(Rest, Handler, Stack, Config); + object -> object(Rest, Handler, Stack, Config); + array -> array(Rest, Handler, Stack, Config); + maybe_done -> maybe_done(Rest, Handler, Stack, Config); + done -> done(Rest, Handler, Stack, Config) + end. + + +-include("jsx_config.hrl"). + + +%% error, incomplete and event macros +-ifndef(error). +-define(error(State, Terms, Handler, Stack, Config), + case Config#config.error_handler of + false -> erlang:error(badarg); + F -> F(Terms, {parser, State, Handler, Stack}, jsx_config:config_to_list(Config)) + end + +). +-endif. + + +incomplete(State, Handler, Stack, Config=#config{stream=false}) -> + ?error(State, [], Handler, Stack, Config); +incomplete(State, Handler, Stack, Config=#config{incomplete_handler=false}) -> + {incomplete, fun(End) when End == end_stream; End == end_json -> + case resume([end_json], State, Handler, Stack, Config) of + {incomplete, _} -> ?error(State, [], Handler, Stack, Config); + Else -> Else + end; + (Tokens) -> + resume(Tokens, State, Handler, Stack, Config) + end + }; +incomplete(State, Handler, Stack, Config=#config{incomplete_handler=F}) -> + F([], {parser, State, Handler, Stack}, jsx_config:config_to_list(Config)). + + +handle_event(Event, {Handler, State}, _Config) -> {Handler, Handler:handle_event(Event, State)}. + + +value([String|Tokens], Handler, Stack, Config) when is_binary(String) -> + try clean_string(String, Config) of Clean -> + maybe_done(Tokens, handle_event({string, Clean}, Handler, Config), Stack, Config) + catch error:badarg -> + ?error(value, [{string, String}|Tokens], Handler, Stack, Config) + end; +value([true|Tokens], Handler, Stack, Config) -> + maybe_done(Tokens, handle_event({literal, true}, Handler, Config), Stack, Config); +value([false|Tokens], Handler, Stack, Config) -> + maybe_done(Tokens, handle_event({literal, false}, Handler, Config), Stack, Config); +value([null|Tokens], Handler, Stack, Config) -> + maybe_done(Tokens, handle_event({literal, null}, Handler, Config), Stack, Config); +value([start_object|Tokens], Handler, Stack, Config) -> + object(Tokens, handle_event(start_object, Handler, Config), [object|Stack], Config); +value([start_array|Tokens], Handler, Stack, Config) -> + array(Tokens, handle_event(start_array, Handler, Config), [array|Stack], Config); +value([Number|Tokens], Handler, Stack, Config) when is_integer(Number) -> + maybe_done(Tokens, handle_event({integer, Number}, Handler, Config), Stack, Config); +value([Number|Tokens], Handler, Stack, Config) when is_float(Number) -> + maybe_done(Tokens, handle_event({float, Number}, Handler, Config), Stack, Config); +value([{raw, Raw}|Tokens], Handler, Stack, Config) when is_binary(Raw) -> + value((jsx:decoder(?MODULE, [], []))(Raw) ++ Tokens, Handler, Stack, Config); +value([{_,_,_}=Timestamp|Tokens], Handler, Stack, Config) -> + {{Year, Month, Day}, {Hour, Min, Sec}} = calendar:now_to_datetime( + Timestamp), + value([{string, unicode:characters_to_binary(io_lib:format( + "~4.10.0B-~2.10.0B-~2.10.0BT~2.10.0B:~2.10.0B:~2.10.0BZ", + [Year, Month, Day, Hour, Min, Sec] + ))}|Tokens], + Handler, + Stack, + Config + ); +value([{{Year, Month, Day}, {Hour, Min, Sec}}|Tokens], Handler, Stack, Config) +when is_integer(Year), is_integer(Month), is_integer(Day), is_integer(Hour), is_integer(Min), is_integer(Sec) -> + value([{string, unicode:characters_to_binary(io_lib:format( + "~4.10.0B-~2.10.0B-~2.10.0BT~2.10.0B:~2.10.0B:~2.10.0BZ", + [Year, Month, Day, Hour, Min, Sec] + ))}|Tokens], + Handler, + Stack, + Config + ); +value([{{Year, Month, Day}, {Hour, Min, Sec}}|Tokens], Handler, Stack, Config) +when is_integer(Year), is_integer(Month), is_integer(Day), is_integer(Hour), is_integer(Min), is_float(Sec) -> + value([{string, unicode:characters_to_binary(io_lib:format( + "~4.10.0B-~2.10.0B-~2.10.0BT~2.10.0B:~2.10.0B:~9.6.0fZ", + [Year, Month, Day, Hour, Min, Sec] + ))}|Tokens], + Handler, + Stack, + Config + ); +value([{literal, Value}|Tokens], Handler, Stack, Config) +when Value == true; Value == false; Value == null -> + value([Value] ++ Tokens, Handler, Stack, Config); +value([{integer, Value}|Tokens], Handler, Stack, Config) +when is_integer(Value) -> + value([Value] ++ Tokens, Handler, Stack, Config); +value([{float, Value}|Tokens], Handler, Stack, Config) +when is_float(Value) -> + value([Value] ++ Tokens, Handler, Stack, Config); +value([{string, Value}|Tokens], Handler, Stack, Config) +when is_binary(Value); is_atom(Value) -> + value([Value] ++ Tokens, Handler, Stack, Config); +value([{number, Value}|Tokens], Handler, Stack, Config) +when is_float(Value); is_integer(Value) -> + value([Value] ++ Tokens, Handler, Stack, Config); +value([String|Tokens], Handler, Stack, Config) when is_atom(String) -> + value([{string, atom_to_binary(String, utf8)}] ++ Tokens, Handler, Stack, Config); +value([], Handler, Stack, Config) -> + incomplete(value, Handler, Stack, Config); +value(BadTokens, Handler, Stack, Config) when is_list(BadTokens) -> + ?error(value, BadTokens, Handler, Stack, Config); +value(Token, Handler, Stack, Config) -> + value([Token], Handler, Stack, Config). + + +object([end_object|Tokens], Handler, [object|Stack], Config) -> + maybe_done(Tokens, handle_event(end_object, Handler, Config), Stack, Config); +object([{key, Key}|Tokens], Handler, Stack, Config) +when is_atom(Key); is_binary(Key); is_integer(Key) -> + object([Key|Tokens], Handler, Stack, Config); +object([Key|Tokens], Handler, [object|Stack], Config) +when is_atom(Key); is_binary(Key); is_integer(Key) -> + try clean_string(fix_key(Key), Config) + of K -> + value( + Tokens, + handle_event({key, K}, Handler, Config), + [object|Stack], + Config + ) + catch error:badarg -> + ?error(object, [{string, Key}|Tokens], Handler, Stack, Config) + end; +object([], Handler, Stack, Config) -> + incomplete(object, Handler, Stack, Config); +object(Token, Handler, Stack, Config) -> + object([Token], Handler, Stack, Config). + + +array([end_array|Tokens], Handler, [array|Stack], Config) -> + maybe_done(Tokens, handle_event(end_array, Handler, Config), Stack, Config); +array([], Handler, Stack, Config) -> + incomplete(array, Handler, Stack, Config); +array(Tokens, Handler, Stack, Config) when is_list(Tokens) -> + value(Tokens, Handler, Stack, Config); +array(Token, Handler, Stack, Config) -> + array([Token], Handler, Stack, Config). + + +maybe_done([end_json], Handler, [], Config) -> + done([end_json], Handler, [], Config); +maybe_done(Tokens, Handler, [object|_] = Stack, Config) when is_list(Tokens) -> + object(Tokens, Handler, Stack, Config); +maybe_done(Tokens, Handler, [array|_] = Stack, Config) when is_list(Tokens) -> + array(Tokens, Handler, Stack, Config); +maybe_done([], Handler, Stack, Config) -> + incomplete(maybe_done, Handler, Stack, Config); +maybe_done(BadTokens, Handler, Stack, Config) when is_list(BadTokens) -> + ?error(maybe_done, BadTokens, Handler, Stack, Config); +maybe_done(Token, Handler, Stack, Config) -> + maybe_done([Token], Handler, Stack, Config). + + +done([], Handler, [], Config=#config{stream=true}) -> + incomplete(done, Handler, [], Config); +done(Tokens, Handler, [], Config) when Tokens == [end_json]; Tokens == [] -> + {_, State} = handle_event(end_json, Handler, Config), + State; +done(BadTokens, Handler, Stack, Config) when is_list(BadTokens) -> + ?error(done, BadTokens, Handler, Stack, Config); +done(Token, Handler, Stack, Config) -> + done([Token], Handler, Stack, Config). + + +fix_key(Key) when is_atom(Key) -> atom_to_binary(Key, utf8); +fix_key(Key) when is_integer(Key) -> list_to_binary(integer_to_list(Key)); +fix_key(Key) when is_binary(Key) -> Key. + + +clean_string(Bin, #config{dirty_strings=true}) -> Bin; +clean_string(Bin, Config) -> clean(Bin, [], Config). + + +%% unroll the control characters +clean(<<0, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(0, Config)], Config); +clean(<<1, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(1, Config)], Config); +clean(<<2, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(2, Config)], Config); +clean(<<3, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(3, Config)], Config); +clean(<<4, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(4, Config)], Config); +clean(<<5, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(5, Config)], Config); +clean(<<6, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(6, Config)], Config); +clean(<<7, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(7, Config)], Config); +clean(<<8, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(8, Config)], Config); +clean(<<9, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(9, Config)], Config); +clean(<<10, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(10, Config)], Config); +clean(<<11, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(11, Config)], Config); +clean(<<12, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(12, Config)], Config); +clean(<<13, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(13, Config)], Config); +clean(<<14, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(14, Config)], Config); +clean(<<15, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(15, Config)], Config); +clean(<<16, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(16, Config)], Config); +clean(<<17, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(17, Config)], Config); +clean(<<18, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(18, Config)], Config); +clean(<<19, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(19, Config)], Config); +clean(<<20, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(20, Config)], Config); +clean(<<21, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(21, Config)], Config); +clean(<<22, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(22, Config)], Config); +clean(<<23, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(23, Config)], Config); +clean(<<24, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(24, Config)], Config); +clean(<<25, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(25, Config)], Config); +clean(<<26, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(26, Config)], Config); +clean(<<27, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(27, Config)], Config); +clean(<<28, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(28, Config)], Config); +clean(<<29, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(29, Config)], Config); +clean(<<30, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(30, Config)], Config); +clean(<<31, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(31, Config)], Config); +clean(<<34, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(34, Config)], Config); +clean(<<47, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(47, Config)], Config); +clean(<<92, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(92, Config)], Config); +clean(<> = Bin, Acc, Config=#config{uescape=true}) -> + case X of + X when X < 16#80 -> start_count(Bin, Acc, Config); + _ -> clean(Rest, [Acc, json_escape_sequence(X)], Config) + end; +%% u+2028 +clean(<<226, 128, 168, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(16#2028, Config)], Config); +%% u+2029 +clean(<<226, 128, 169, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(16#2029, Config)], Config); +clean(<<_/utf8, _/binary>> = Bin, Acc, Config) -> start_count(Bin, Acc, Config); +%% surrogates +clean(<<237, X, _, Rest/binary>>, Acc, Config) when X >= 160 -> + clean(Rest, [Acc, maybe_replace(surrogate, Config)], Config); +%% overlong encodings and missing continuations of a 2 byte sequence +clean(<>, Acc, Config) when X >= 192, X =< 223 -> + clean(strip_continuations(Rest, 1), [Acc, maybe_replace(badutf, Config)], Config); +%% overlong encodings and missing continuations of a 3 byte sequence +clean(<>, Acc, Config) when X >= 224, X =< 239 -> + clean(strip_continuations(Rest, 2), [Acc, maybe_replace(badutf, Config)], Config); +%% overlong encodings and missing continuations of a 4 byte sequence +clean(<>, Acc, Config) when X >= 240, X =< 247 -> + clean(strip_continuations(Rest, 3), [Acc, maybe_replace(badutf, Config)], Config); +clean(<<_, Rest/binary>>, Acc, Config) -> + clean(Rest, [Acc, maybe_replace(badutf, Config)], Config); +clean(<<>>, Acc, _) -> iolist_to_binary(Acc). + + +start_count(Bin, Acc, Config) -> + Size = count(Bin, 0, Config), + <> = Bin, + clean(Rest, [Acc, Clean], Config). + + +%% again, unrolling ascii makes a huge difference. sadly +count(<<0, _/binary>>, N, _) -> N; +count(<<1, _/binary>>, N, _) -> N; +count(<<2, _/binary>>, N, _) -> N; +count(<<3, _/binary>>, N, _) -> N; +count(<<4, _/binary>>, N, _) -> N; +count(<<5, _/binary>>, N, _) -> N; +count(<<6, _/binary>>, N, _) -> N; +count(<<7, _/binary>>, N, _) -> N; +count(<<8, _/binary>>, N, _) -> N; +count(<<9, _/binary>>, N, _) -> N; +count(<<10, _/binary>>, N, _) -> N; +count(<<11, _/binary>>, N, _) -> N; +count(<<12, _/binary>>, N, _) -> N; +count(<<13, _/binary>>, N, _) -> N; +count(<<14, _/binary>>, N, _) -> N; +count(<<15, _/binary>>, N, _) -> N; +count(<<16, _/binary>>, N, _) -> N; +count(<<17, _/binary>>, N, _) -> N; +count(<<18, _/binary>>, N, _) -> N; +count(<<19, _/binary>>, N, _) -> N; +count(<<20, _/binary>>, N, _) -> N; +count(<<21, _/binary>>, N, _) -> N; +count(<<22, _/binary>>, N, _) -> N; +count(<<23, _/binary>>, N, _) -> N; +count(<<24, _/binary>>, N, _) -> N; +count(<<25, _/binary>>, N, _) -> N; +count(<<26, _/binary>>, N, _) -> N; +count(<<27, _/binary>>, N, _) -> N; +count(<<28, _/binary>>, N, _) -> N; +count(<<29, _/binary>>, N, _) -> N; +count(<<30, _/binary>>, N, _) -> N; +count(<<31, _/binary>>, N, _) -> N; +count(<<32, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<33, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<34, _/binary>>, N, _) -> N; +count(<<35, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<36, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<37, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<38, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<39, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<40, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<41, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<42, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<43, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<44, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<45, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<46, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<47, _/binary>>, N, _) -> N; +count(<<48, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<49, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<50, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<51, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<52, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<53, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<54, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<55, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<56, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<57, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<58, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<59, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<60, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<61, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<62, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<63, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<64, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<65, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<66, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<67, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<68, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<69, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<70, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<71, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<72, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<73, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<74, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<75, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<76, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<77, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<78, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<79, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<80, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<81, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<82, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<83, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<84, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<85, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<86, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<87, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<88, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<89, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<90, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<91, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<92, _/binary>>, N, _) -> N; +count(<<93, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<94, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<95, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<96, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<97, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<98, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<99, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<100, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<101, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<102, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<103, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<104, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<105, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<106, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<107, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<108, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<109, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<110, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<111, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<112, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<113, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<114, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<115, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<116, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<117, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<118, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<119, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<120, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<121, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<122, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<123, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<124, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<125, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<126, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<127, Rest/binary>>, N, Config) -> + count(Rest, N + 1, Config); +count(<<_/utf8, _/binary>>, N, #config{uescape=true}) -> N; +count(<>, N, Config) -> + case X of + X when X < 16#800 -> count(Rest, N + 2, Config); + 16#2028 -> N; + 16#2029 -> N; + X when X < 16#10000 -> count(Rest, N + 3, Config); + _ -> count(Rest, N + 4, Config) + end; +count(<<_, _/binary>>, N, _) -> N; +count(<<>>, N, _) -> N. + + +strip_continuations(Bin, 0) -> Bin; +strip_continuations(<>, N) when X >= 128, X =< 191 -> + strip_continuations(Rest, N - 1); +%% not a continuation byte +strip_continuations(Bin, _) -> Bin. + + +maybe_replace($\b, #config{escaped_strings=true}) -> <<$\\, $b>>; +maybe_replace($\t, #config{escaped_strings=true}) -> <<$\\, $t>>; +maybe_replace($\n, #config{escaped_strings=true}) -> <<$\\, $n>>; +maybe_replace($\f, #config{escaped_strings=true}) -> <<$\\, $f>>; +maybe_replace($\r, #config{escaped_strings=true}) -> <<$\\, $r>>; +maybe_replace($\", #config{escaped_strings=true}) -> <<$\\, $\">>; +maybe_replace($/, Config=#config{escaped_strings=true}) -> + case Config#config.escaped_forward_slashes of + true -> <<$\\, $/>>; + false -> <<$/>> + end; +maybe_replace($\\, #config{escaped_strings=true}) -> <<$\\, $\\>>; +maybe_replace(X, #config{escaped_strings=true}) when X < 32 -> + json_escape_sequence(X); +maybe_replace(X, Config=#config{escaped_strings=true}) when X == 16#2028; X == 16#2029 -> + case Config#config.unescaped_jsonp of + true -> <>; + false -> json_escape_sequence(X) + end; +maybe_replace(Atom, #config{strict_utf8=true}) when is_atom(Atom) -> + erlang:error(badarg); +maybe_replace(surrogate, _Config) -> + <<16#fffd/utf8>>; +maybe_replace(badutf, _Config) -> + <<16#fffd/utf8>>; +maybe_replace(X, _Config) -> + <>. + + +%% convert a codepoint to it's \uXXXX equiv. +json_escape_sequence(X) when X < 65536 -> + <> = <>, + <<$\\, $u, (to_hex(A)), (to_hex(B)), (to_hex(C)), (to_hex(D))>>; +json_escape_sequence(X) -> + Adjusted = X - 16#10000, + <> = <>, + [json_escape_sequence(A + 16#d800), json_escape_sequence(B + 16#dc00)]. + + +to_hex(10) -> $a; +to_hex(11) -> $b; +to_hex(12) -> $c; +to_hex(13) -> $d; +to_hex(14) -> $e; +to_hex(15) -> $f; +to_hex(X) -> X + 48. %% ascii "1" is [49], "2" is [50], etc... + + +%% for raw input +-spec init([]) -> []. + +init([]) -> []. + + +-spec handle_event(Event::any(), Acc::list()) -> list(). + +handle_event(end_json, State) -> lists:reverse(State); +handle_event(Event, State) -> [Event] ++ State. + + + +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +parse(Events, Config) -> value(Events, {jsx, []}, [], jsx_config:parse_config(Config)). + + +error_test_() -> + [ + {"value error", ?_assertError(badarg, parse([self()], []))}, + {"maybe_done error", ?_assertError(badarg, parse([start_array, end_array, start_array, end_json], []))}, + {"done error", ?_assertError(badarg, parse([{string, <<"">>}, {literal, true}, end_json], []))}, + {"string error", ?_assertError(badarg, parse([{string, <<237, 160, 128>>}, end_json], [strict]))} + ]. + + +custom_error_handler_test_() -> + Error = fun(Rest, {_, State, _, _}, _) -> {State, Rest} end, + [ + {"value error", ?_assertEqual( + {value, [self()]}, + parse([self()], [{error_handler, Error}]) + )}, + {"maybe_done error", ?_assertEqual( + {maybe_done, [start_array, end_json]}, + parse([start_array, end_array, start_array, end_json], [{error_handler, Error}]) + )}, + {"done error", ?_assertEqual( + {maybe_done, [{literal, true}, end_json]}, + parse([{string, <<"">>}, {literal, true}, end_json], [{error_handler, Error}]) + )}, + {"string error", ?_assertEqual( + {value, [{string, <<237, 160, 128>>}, end_json]}, + parse([{string, <<237, 160, 128>>}, end_json], [{error_handler, Error}, strict]) + )} + ]. + + +incomplete_test_() -> + Cases = [ + {"incomplete value", []}, + {"incomplete object", [start_object]}, + {"incomplete array", [start_array]}, + {"incomplete maybe_done", [start_array, end_array]} + ], + [{Title, ?_assertError(badarg, parse(Events, []))} + || {Title, Events} <- Cases + ]. + + +custom_incomplete_handler_test_() -> + [ + {"custom incomplete handler", ?_assertError( + badarg, + parse([], [{incomplete_handler, fun(_, _, _) -> erlang:error(badarg) end}]) + )} + ]. + + +raw_test_() -> + Parse = fun(Events, Config) -> (parser(?MODULE, [], Config))(Events ++ [end_json]) end, + [ + {"raw empty list", ?_assertEqual( + [start_array, end_array], + Parse([{raw, <<"[]">>}], []) + )}, + {"raw empty object", ?_assertEqual( + [start_object, end_object], + Parse([{raw, <<"{}">>}], []) + )}, + {"raw chunk inside stream", ?_assertEqual( + [start_object, {key, <<"key">>}, start_array, {literal, true}, end_array, end_object], + Parse([start_object, {key, <<"key">>}, {raw, <<"[true]">>}, end_object], []) + )} + ]. + + +%% erlang refuses to encode certain codepoints, so fake them +to_fake_utf8(N) when N < 16#0080 -> <>; +to_fake_utf8(N) when N < 16#0800 -> + <<0:5, Y:5, X:6>> = <>, + <<2#110:3, Y:5, 2#10:2, X:6>>; +to_fake_utf8(N) when N < 16#10000 -> + <> = <>, + <<2#1110:4, Z:4, 2#10:2, Y:6, 2#10:2, X:6>>; +to_fake_utf8(N) -> + <<0:3, W:3, Z:6, Y:6, X:6>> = <>, + <<2#11110:5, W:3, 2#10:2, Z:6, 2#10:2, Y:6, 2#10:2, X:6>>. + + +codepoints() -> + unicode:characters_to_binary( + [32, 33] + ++ lists:seq(35, 46) + ++ lists:seq(48, 91) + ++ lists:seq(93, 16#2027) + ++ lists:seq(16#202a, 16#d7ff) + ++ lists:seq(16#e000, 16#ffff) + ). + + +extended_codepoints() -> + unicode:characters_to_binary( + lists:seq(16#10000, 16#1ffff) ++ [ + 16#20000, 16#30000, 16#40000, 16#50000, 16#60000, + 16#70000, 16#80000, 16#90000, 16#a0000, 16#b0000, + 16#c0000, 16#d0000, 16#e0000, 16#f0000, 16#100000 + ] + ). + + +surrogates() -> [ to_fake_utf8(N) || N <- lists:seq(16#d800, 16#dfff) ]. + + +clean_string_helper(String) -> + try clean_string(String, #config{strict_utf8=true}) of Clean -> Clean + catch error:badarg -> {error, badarg} + end. + + +clean_string_test_() -> + [ + {"clean codepoints", ?_assertEqual( + codepoints(), + clean_string(codepoints(), #config{}) + )}, + {"clean extended codepoints", ?_assertEqual( + extended_codepoints(), + clean_string(extended_codepoints(), #config{}) + )}, + {"escape path codepoints", ?_assertEqual( + codepoints(), + clean_string(codepoints(), #config{escaped_strings=true}) + )}, + {"escape path extended codepoints", ?_assertEqual( + extended_codepoints(), + clean_string(extended_codepoints(), #config{escaped_strings=true}) + )}, + {"error surrogates", ?_assertEqual( + lists:duplicate(length(surrogates()), {error, badarg}), + lists:map(fun(Codepoint) -> clean_string_helper(Codepoint) end, surrogates()) + )}, + {"clean surrogates", ?_assertEqual( + lists:duplicate(length(surrogates()), <<16#fffd/utf8>>), + lists:map(fun(Codepoint) -> clean_string(Codepoint, #config{}) end, surrogates()) + )} + ]. + + +escape_test_() -> + [ + {"maybe_escape backspace", ?_assertEqual( + <<"\\b">>, + clean_string(<<16#0008/utf8>>, #config{escaped_strings=true}) + )}, + {"don't escape backspace", ?_assertEqual( + <<"\b">>, + clean_string(<<16#0008/utf8>>, #config{}) + )}, + {"maybe_escape tab", ?_assertEqual( + <<"\\t">>, + clean_string(<<16#0009/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape newline", ?_assertEqual( + <<"\\n">>, + clean_string(<<16#000a/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape formfeed", ?_assertEqual( + <<"\\f">>, + clean_string(<<16#000c/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape carriage return", ?_assertEqual( + <<"\\r">>, + clean_string(<<16#000d/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape quote", ?_assertEqual( + <<"\\\"">>, + clean_string(<<16#0022/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape forward slash", ?_assertEqual( + <<"\\/">>, + clean_string(<<16#002f/utf8>>, #config{escaped_strings=true, escaped_forward_slashes=true}) + )}, + {"do not maybe_escape forward slash", ?_assertEqual( + <<"/">>, + clean_string(<<16#002f/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape backslash", ?_assertEqual( + <<"\\\\">>, + clean_string(<<16#005c/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape jsonp (u2028)", ?_assertEqual( + <<"\\u2028">>, + clean_string(<<16#2028/utf8>>, #config{escaped_strings=true}) + )}, + {"do not maybe_escape jsonp (u2028)", ?_assertEqual( + <<16#2028/utf8>>, + clean_string(<<16#2028/utf8>>, #config{escaped_strings=true, unescaped_jsonp=true}) + )}, + {"maybe_escape jsonp (u2029)", ?_assertEqual( + <<"\\u2029">>, + clean_string(<<16#2029/utf8>>, #config{escaped_strings=true}) + )}, + {"do not maybe_escape jsonp (u2029)", ?_assertEqual( + <<16#2029/utf8>>, + clean_string(<<16#2029/utf8>>, #config{escaped_strings=true, unescaped_jsonp=true}) + )}, + {"maybe_escape u0000", ?_assertEqual( + <<"\\u0000">>, + clean_string(<<16#0000/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0001", ?_assertEqual( + <<"\\u0001">>, + clean_string(<<16#0001/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0002", ?_assertEqual( + <<"\\u0002">>, + clean_string(<<16#0002/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0003", ?_assertEqual( + <<"\\u0003">>, + clean_string(<<16#0003/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0004", ?_assertEqual( + <<"\\u0004">>, + clean_string(<<16#0004/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0005", ?_assertEqual( + <<"\\u0005">>, + clean_string(<<16#0005/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0006", ?_assertEqual( + <<"\\u0006">>, + clean_string(<<16#0006/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0007", ?_assertEqual( + <<"\\u0007">>, + clean_string(<<16#0007/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u000b", ?_assertEqual( + <<"\\u000b">>, + clean_string(<<16#000b/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u000e", ?_assertEqual( + <<"\\u000e">>, + clean_string(<<16#000e/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u000f", ?_assertEqual( + <<"\\u000f">>, + clean_string(<<16#000f/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0010", ?_assertEqual( + <<"\\u0010">>, + clean_string(<<16#0010/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0011", ?_assertEqual( + <<"\\u0011">>, + clean_string(<<16#0011/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0012", ?_assertEqual( + <<"\\u0012">>, + clean_string(<<16#0012/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0013", ?_assertEqual( + <<"\\u0013">>, + clean_string(<<16#0013/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0014", ?_assertEqual( + <<"\\u0014">>, + clean_string(<<16#0014/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0015", ?_assertEqual( + <<"\\u0015">>, + clean_string(<<16#0015/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0016", ?_assertEqual( + <<"\\u0016">>, + clean_string(<<16#0016/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0017", ?_assertEqual( + <<"\\u0017">>, + clean_string(<<16#0017/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0018", ?_assertEqual( + <<"\\u0018">>, + clean_string(<<16#0018/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u0019", ?_assertEqual( + <<"\\u0019">>, + clean_string(<<16#0019/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001a", ?_assertEqual( + <<"\\u001a">>, + clean_string(<<16#001a/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001b", ?_assertEqual( + <<"\\u001b">>, + clean_string(<<16#001b/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001c", ?_assertEqual( + <<"\\u001c">>, + clean_string(<<16#001c/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001d", ?_assertEqual( + <<"\\u001d">>, + clean_string(<<16#001d/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001e", ?_assertEqual( + <<"\\u001e">>, + clean_string(<<16#001e/utf8>>, #config{escaped_strings=true}) + )}, + {"maybe_escape u001f", ?_assertEqual( + <<"\\u001f">>, + clean_string(<<16#001f/utf8>>, #config{escaped_strings=true}) + )} + ]. + + +bad_utf8_test_() -> + [ + {"orphan continuation byte u+0080", ?_assertError( + badarg, + clean_string(<<16#0080>>, #config{strict_utf8=true}) + )}, + {"orphan continuation byte u+0080 replaced", ?_assertEqual( + <<16#fffd/utf8>>, + clean_string(<<16#0080>>, #config{}) + )}, + {"orphan continuation byte u+00bf", ?_assertError( + badarg, + clean_string(<<16#00bf>>, #config{strict_utf8=true}) + )}, + {"orphan continuation byte u+00bf replaced", ?_assertEqual( + <<16#fffd/utf8>>, + clean_string(<<16#00bf>>, #config{}) + )}, + {"2 continuation bytes", ?_assertError( + badarg, + clean_string(<<(binary:copy(<<16#0080>>, 2))/binary>>, #config{strict_utf8=true}) + )}, + {"2 continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, 2), + clean_string(<<(binary:copy(<<16#0080>>, 2))/binary>>, #config{}) + )}, + {"3 continuation bytes", ?_assertError( + badarg, + clean_string(<<(binary:copy(<<16#0080>>, 3))/binary>>, #config{strict_utf8=true}) + )}, + {"3 continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, 3), + clean_string(<<(binary:copy(<<16#0080>>, 3))/binary>>, #config{}) + )}, + {"4 continuation bytes", ?_assertError( + badarg, + clean_string(<<(binary:copy(<<16#0080>>, 4))/binary>>, #config{strict_utf8=true}) + )}, + {"4 continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, 4), + clean_string(<<(binary:copy(<<16#0080>>, 4))/binary>>, #config{}) + )}, + {"5 continuation bytes", ?_assertError( + badarg, + clean_string(<<(binary:copy(<<16#0080>>, 5))/binary>>, #config{strict_utf8=true}) + )}, + {"5 continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, 5), + clean_string(<<(binary:copy(<<16#0080>>, 5))/binary>>, #config{}) + )}, + {"6 continuation bytes", ?_assertError( + badarg, + clean_string(<<(binary:copy(<<16#0080>>, 6))/binary>>, #config{strict_utf8=true}) + )}, + {"6 continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, 6), + clean_string(<<(binary:copy(<<16#0080>>, 6))/binary>>, #config{}) + )}, + {"all continuation bytes", ?_assertError( + badarg, + clean_string(<<(list_to_binary(lists:seq(16#0080, 16#00bf)))/binary>>, #config{strict_utf8=true}) + )}, + {"all continuation bytes replaced", ?_assertEqual( + binary:copy(<<16#fffd/utf8>>, length(lists:seq(16#0080, 16#00bf))), + clean_string( + <<(list_to_binary(lists:seq(16#0080, 16#00bf)))/binary>>, + #config{} + ) + )}, + {"lonely start byte", ?_assertError( + badarg, + clean_string(<<16#00c0>>, #config{strict_utf8=true}) + )}, + {"lonely start byte replaced", ?_assertEqual( + <<16#fffd/utf8>>, + clean_string(<<16#00c0>>, #config{}) + )}, + {"lonely start bytes (2 byte)", ?_assertError( + badarg, + clean_string(<<16#00c0, 32, 16#00df>>, #config{strict_utf8=true}) + )}, + {"lonely start bytes (2 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + clean_string(<<16#00c0, 32, 16#00df>>, #config{}) + )}, + {"lonely start bytes (3 byte)", ?_assertError( + badarg, + clean_string(<<16#00e0, 32, 16#00ef>>, #config{strict_utf8=true}) + )}, + {"lonely start bytes (3 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + clean_string(<<16#00e0, 32, 16#00ef>>, #config{}) + )}, + {"lonely start bytes (4 byte)", ?_assertError( + badarg, + clean_string(<<16#00f0, 32, 16#00f7>>, #config{strict_utf8=true}) + )}, + {"lonely start bytes (4 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32, 16#fffd/utf8>>, + clean_string(<<16#00f0, 32, 16#00f7>>, #config{}) + )}, + {"missing continuation byte (3 byte)", ?_assertError( + badarg, + clean_string(<<224, 160, 32>>, #config{strict_utf8=true}) + )}, + {"missing continuation byte (3 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<224, 160, 32>>, #config{}) + )}, + {"missing continuation byte (4 byte missing one)", ?_assertError( + badarg, + clean_string(<<240, 144, 128, 32>>, #config{strict_utf8=true}) + )}, + {"missing continuation byte (4 byte missing one) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<240, 144, 128, 32>>, #config{}) + )}, + {"missing continuation byte (4 byte missing two)", ?_assertError( + badarg, + clean_string(<<240, 144, 32>>, #config{strict_utf8=true}) + )}, + {"missing continuation byte (4 byte missing two) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<240, 144, 32>>, #config{}) + )}, + {"overlong encoding of u+002f (2 byte)", ?_assertError( + badarg, + clean_string(<<16#c0, 16#af, 32>>, #config{strict_utf8=true}) + )}, + {"overlong encoding of u+002f (2 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#c0, 16#af, 32>>, #config{}) + )}, + {"overlong encoding of u+002f (3 byte)", ?_assertError( + badarg, + clean_string(<<16#e0, 16#80, 16#af, 32>>, #config{strict_utf8=true}) + )}, + {"overlong encoding of u+002f (3 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#e0, 16#80, 16#af, 32>>, #config{}) + )}, + {"overlong encoding of u+002f (4 byte)", ?_assertError( + badarg, + clean_string(<<16#f0, 16#80, 16#80, 16#af, 32>>, #config{strict_utf8=true}) + )}, + {"overlong encoding of u+002f (4 byte) replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#f0, 16#80, 16#80, 16#af, 32>>, #config{}) + )}, + {"highest overlong 2 byte sequence", ?_assertError( + badarg, + clean_string(<<16#c1, 16#bf, 32>>, #config{strict_utf8=true}) + )}, + {"highest overlong 2 byte sequence replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#c1, 16#bf, 32>>, #config{}) + )}, + {"highest overlong 3 byte sequence", ?_assertError( + badarg, + clean_string(<<16#e0, 16#9f, 16#bf, 32>>, #config{strict_utf8=true}) + )}, + {"highest overlong 3 byte sequence replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#e0, 16#9f, 16#bf, 32>>, #config{}) + )}, + {"highest overlong 4 byte sequence", ?_assertError( + badarg, + clean_string(<<16#f0, 16#8f, 16#bf, 16#bf, 32>>, #config{strict_utf8=true}) + )}, + {"highest overlong 4 byte sequence replaced", ?_assertEqual( + <<16#fffd/utf8, 32>>, + clean_string(<<16#f0, 16#8f, 16#bf, 16#bf, 32>>, #config{}) + )} + ]. + + +json_escape_sequence_test_() -> + [ + {"json escape sequence test - 16#0000", ?_assertEqual(<<"\\u0000"/utf8>>, json_escape_sequence(16#0000))}, + {"json escape sequence test - 16#abc", ?_assertEqual(<<"\\u0abc"/utf8>>, json_escape_sequence(16#abc))}, + {"json escape sequence test - 16#def", ?_assertEqual(<<"\\u0def"/utf8>>, json_escape_sequence(16#def))} + ]. + + +uescape_test_() -> + [ + {"\"\\u0080\"", ?_assertEqual( + <<"\\u0080">>, + clean_string(<<128/utf8>>, #config{uescape=true}) + )}, + {"\"\\u8ca8\\u5481\\u3002\\u0091\\u0091\"", ?_assertEqual( + <<"\\u8ca8\\u5481\\u3002\\u0091\\u0091">>, + clean_string( + <<232,178,168,229,146,129,227,128,130,194,145,194,145>>, + #config{uescape=true} + ) + )}, + {"\"\\ud834\\udd1e\"", ?_assertEqual( + <<"\\ud834\\udd1e">>, + clean_string(<<240, 157, 132, 158>>, #config{uescape=true}) + )}, + {"\"\\ud83d\\ude0a\"", ?_assertEqual( + <<"\\ud83d\\ude0a">>, + clean_string(<<240, 159, 152, 138>>, #config{uescape=true}) + )} + ]. + + +fix_key_test_() -> + [ + {"binary key", ?_assertEqual(fix_key(<<"foo">>), <<"foo">>)}, + {"atom key", ?_assertEqual(fix_key(foo), <<"foo">>)}, + {"integer key", ?_assertEqual(fix_key(123), <<"123">>)} + ]. + + +datetime_test_() -> + [ + {"datetime", ?_assertEqual( + [start_array, {string, <<"2014-08-13T23:12:34Z">>}, end_array, end_json], + parse([start_array, {{2014,08,13},{23,12,34}}, end_array, end_json], []) + )}, + {"datetime", ?_assertEqual( + [start_array, {string, <<"2014-08-13T23:12:34.363369Z">>}, end_array, end_json], + parse([start_array, {{2014,08,13},{23,12,34.363369}}, end_array, end_json], []) + )} + ]. + + +timestamp_test_() -> + [ + {"timestamp", ?_assertEqual( + [start_array, {string, <<"2016-01-15T18:19:28Z">>}, end_array, end_json], + parse([start_array, {1452,881968,111772}, end_array, end_json], []) + )} + ]. + + +rogue_tuple_test_() -> + [ + {"kv in value position of object", ?_assertError( + badarg, + parse([start_object, <<"key">>, {<<"key">>, <<"value">>}, end_object, end_json], []) + )}, + {"kv in value position of list", ?_assertError( + badarg, + parse([start_array, {<<"key">>, <<"value">>}, end_array, end_json], []) + )} + ]. + + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_to_json.erl b/server/_build/default/lib/jsx/src/jsx_to_json.erl new file mode 100644 index 0000000..d20add6 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_to_json.erl @@ -0,0 +1,408 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 alisdair sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_to_json). + +-export([to_json/2, format/2]). +-export([init/1, handle_event/2]). +-export([start_json/0, start_json/1]). +-export([start_object/1, start_array/1, finish/1, insert/2, get_key/1, get_value/1]). + + +-record(config, { + space = 0, + indent = 0, + depth = 0, + newline = <<$\n>> +}). + +-type config() :: proplists:proplist(). + + +-spec to_json(Source::jsx:json_term(), Config::jsx_config:options()) -> binary(). + +to_json(Source, Config) when is_list(Config) -> + (jsx:encoder(?MODULE, Config, jsx_config:extract_config(Config ++ [escaped_strings])))(Source). + + +-spec format(Source::binary(), Config::jsx_config:options()) -> jsx:json_text(). + +format(Source, Config) when is_binary(Source) andalso is_list(Config) -> + (jsx:decoder(?MODULE, Config, jsx_config:extract_config(Config ++ [escaped_strings])))(Source); +format(_, _) -> erlang:error(badarg). + + +parse_config(Config) -> parse_config(Config, #config{}). + +parse_config([{space, Val}|Rest], Config) when is_integer(Val), Val > 0 -> + parse_config(Rest, Config#config{space = Val}); +parse_config([space|Rest], Config) -> + parse_config(Rest, Config#config{space = 1}); +parse_config([{indent, Val}|Rest], Config) when is_integer(Val), Val > 0 -> + parse_config(Rest, Config#config{indent = Val}); +parse_config([indent|Rest], Config) -> + parse_config(Rest, Config#config{indent = 1}); +parse_config([{newline, Val}|Rest], Config) when is_binary(Val) -> + parse_config(Rest, Config#config{newline = Val}); +parse_config([{K, _}|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config) + ; false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([K|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config) + ; false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([], Config) -> + Config. + + +-define(start_object, <<"{">>). +-define(start_array, <<"[">>). +-define(end_object, <<"}">>). +-define(end_array, <<"]">>). +-define(colon, <<":">>). +-define(comma, <<",">>). +-define(quote, <<"\"">>). +-define(space, <<" ">>). +-define(newline, <<"\n">>). + + +-type state() :: {unicode:charlist(), #config{}}. +-spec init(Config::config()) -> state(). + +init(Config) -> {[], parse_config(Config)}. + + +-spec handle_event(Event::any(), State::state()) -> state(). + +handle_event(end_json, State) -> get_value(State); + +handle_event(start_object, State) -> start_object(State); +handle_event(end_object, State) -> finish(State); + +handle_event(start_array, State) -> start_array(State); +handle_event(end_array, State) -> finish(State); + +handle_event({Type, Event}, {_, Config} = State) -> insert(encode(Type, Event, Config), State). + + +encode(string, String, _Config) -> + [?quote, String, ?quote]; +encode(key, Key, _Config) -> + [?quote, Key, ?quote]; +encode(literal, Literal, _Config) -> + erlang:atom_to_list(Literal); +encode(integer, Integer, _Config) -> + erlang:integer_to_list(Integer); +encode(float, Float, _Config) -> + io_lib:format("~p", [Float]). + + +space(Config) -> + case Config#config.space of + 0 -> <<>> + ; X when X > 0 -> binary:copy(?space, X) + end. + + +indent(Config) -> + case Config#config.indent of + 0 -> <<>> + ; X when X > 0 -> <<(Config#config.newline)/binary, (binary:copy(?space, X * Config#config.depth))/binary>> + end. + + +indent_or_space(Config) -> + case Config#config.indent > 0 of + true -> indent(Config) + ; false -> space(Config) + end. + + +%% internal state is a stack and a config object +%% `{Stack, Config}` +%% the stack is a list of in progress objects/arrays +%% `[Current, Parent, Grandparent,...OriginalAncestor]` +%% an object has the representation on the stack of +%% `{object, Object}` +%% of if there's a key with a yet to be matched value +%% `{object, Key, Object}` +%% an array looks like +%% `{array, Array}` +%% `Object` and `Array` are utf8 encoded binaries + +start_json() -> {[], #config{}}. + +start_json(Config) when is_list(Config) -> {[], parse_config(Config)}. + +%% allocate a new object on top of the stack +start_object({Stack, Config = #config{depth = Depth}}) -> + {[{object, ?start_object}] ++ Stack, Config#config{depth = Depth + 1}}. + +%% allocate a new array on top of the stack +start_array({Stack, Config = #config{depth = Depth}}) -> + {[{array, ?start_array}] ++ Stack, Config#config{depth = Depth + 1}}. + +%% finish an object or array and insert it into the parent object if it exists +finish({Stack, Config = #config{depth = Depth}}) -> + NewConfig = Config#config{depth = Depth - 1}, + finish_({Stack, NewConfig}). + +finish_({[{object, <<"{">>}], Config}) -> {<<"{}">>, Config}; +finish_({[{array, <<"[">>}], Config}) -> {<<"[]">>, Config}; +finish_({[{object, <<"{">>}|Rest], Config}) -> insert(<<"{}">>, {Rest, Config}); +finish_({[{array, <<"[">>}|Rest], Config}) -> insert(<<"[]">>, {Rest, Config}); +finish_({[{object, Object}], Config}) -> + {[Object, indent(Config), ?end_object], Config}; +finish_({[{object, Object}|Rest], Config}) -> + insert([Object, indent(Config), ?end_object], {Rest, Config}); +finish_({[{array, Array}], Config}) -> + {[Array, indent(Config), ?end_array], Config}; +finish_({[{array, Array}|Rest], Config}) -> + insert([Array, indent(Config), ?end_array], {Rest, Config}); +finish_(_) -> erlang:error(badarg). + +%% insert a value when there's no parent object or array +insert(Value, {[], Config}) -> + {Value, Config}; +%% insert a key or value into an object or array, autodetects the 'right' thing +insert(Key, {[{object, Object}|Rest], Config}) -> + {[{object, Key, Object}] ++ Rest, Config}; +insert(Value, {[{object, Key, ?start_object}|Rest], Config}) -> + { + [{object, [ + ?start_object, + indent(Config), + Key, + ?colon, + space(Config), + Value + ]}] ++ Rest, + Config + }; +insert(Value, {[{object, Key, Object}|Rest], Config}) -> + { + [{object, [ + Object, + ?comma, + indent_or_space(Config), + Key, + ?colon, + space(Config), + Value + ]}] ++ Rest, + Config + }; +insert(Value, {[{array, ?start_array}|Rest], Config}) -> + {[{array, [?start_array, indent(Config), Value]}] ++ Rest, Config}; +insert(Value, {[{array, Array}|Rest], Config}) -> + { + [{array, [Array, + ?comma, + indent_or_space(Config), + Value + ]}] ++ Rest, + Config + }; +insert(_, _) -> erlang:error(badarg). + + +get_key({[{object, Key, _}|_], _}) -> Key; +get_key(_) -> erlang:error(badarg). + + +get_value({Value, _Config}) -> + try unicode:characters_to_binary(Value) + catch error:_ -> erlang:error(badarg) + end; +get_value(_) -> erlang:error(badarg). + + + +%% eunit tests + +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +config_test_() -> + [ + {"empty config", ?_assertEqual(#config{}, parse_config([]))}, + {"unspecified indent/space", ?_assertEqual( + #config{space=1, indent=1}, + parse_config([space, indent]) + )}, + {"specific indent", ?_assertEqual( + #config{indent=4}, + parse_config([{indent, 4}]) + )}, + {"specific space", ?_assertEqual( + #config{space=2}, + parse_config([{space, 2}]) + )}, + {"specific space and indent", ?_assertEqual( + #config{space=2, indent=2}, + parse_config([{space, 2}, {indent, 2}]) + )}, + {"invalid opt flag", ?_assertError(badarg, parse_config([error]))}, + {"invalid opt tuple", ?_assertError(badarg, parse_config([{error, true}]))} + ]. + + +space_test_() -> + [ + {"no space", ?_assertEqual(<<>>, space(#config{space=0}))}, + {"one space", ?_assertEqual(<<" ">>, space(#config{space=1}))}, + {"four spaces", ?_assertEqual(<<" ">>, space(#config{space=4}))} + ]. + + +indent_test_() -> + [ + {"no indent", ?_assertEqual(<<>>, indent(#config{indent=0, depth=1}))}, + {"indent 1 depth 1", ?_assertEqual( + <>/binary>>, + indent(#config{indent=1, depth=1}) + )}, + {"indent 1 depth 2", ?_assertEqual( + <>/binary>>, + indent(#config{indent=1, depth=2}) + )}, + {"indent 4 depth 1", ?_assertEqual( + <>/binary>>, + indent(#config{indent=4, depth=1}) + )}, + {"indent 4 depth 2", ?_assertEqual( + <>/binary, <<" ">>/binary>>, + indent(#config{indent=4, depth=2}) + )} + ]. + + +indent_or_space_test_() -> + [ + {"no indent so space", ?_assertEqual( + <<" ">>, + indent_or_space(#config{space=1, indent=0, depth=1}) + )}, + {"indent so no space", ?_assertEqual( + <>/binary>>, + indent_or_space(#config{space=1, indent=1, depth=1}) + )} + ]. + + +encode_test_() -> + [ + {"0.0", ?_assert(encode(float, 0.0, #config{}) =:= ["0.0"])}, + {"1.0", ?_assert(encode(float, 1.0, #config{}) =:= ["1.0"])}, + {"-1.0", ?_assert(encode(float, -1.0, #config{}) =:= ["-1.0"])}, + {"3.1234567890987654321", + ?_assert( + encode(float, 3.1234567890987654321, #config{}) =:= ["3.1234567890987655"]) + }, + {"1.0e23", ?_assert(encode(float, 1.0e23, #config{}) =:= ["1.0e23"])}, + {"0.3", ?_assert(encode(float, 3.0/10.0, #config{}) =:= ["0.3"])}, + {"0.0001", ?_assert(encode(float, 0.0001, #config{}) =:= ["0.0001"])}, + {"0.00001", ?_assert(encode(float, 0.00001, #config{}) =:= ["1.0e-5"])}, + {"0.00000001", ?_assert(encode(float, 0.00000001, #config{}) =:= ["1.0e-8"])}, + {"1.0e-323", ?_assert(encode(float, 1.0e-323, #config{}) =:= ["1.0e-323"])}, + {"1.0e308", ?_assert(encode(float, 1.0e308, #config{}) =:= ["1.0e308"])}, + {"min normalized float", + ?_assert( + encode(float, math:pow(2, -1022), #config{}) =:= ["2.2250738585072014e-308"] + ) + }, + {"max normalized float", + ?_assert( + encode(float, (2 - math:pow(2, -52)) * math:pow(2, 1023), #config{}) + =:= ["1.7976931348623157e308"] + ) + }, + {"min denormalized float", + ?_assert(encode(float, math:pow(2, -1074), #config{}) =:= ["5.0e-324"]) + }, + {"max denormalized float", + ?_assert( + encode(float, (1 - math:pow(2, -52)) * math:pow(2, -1022), #config{}) + =:= ["2.225073858507201e-308"] + ) + }, + {"hello world", ?_assert(encode(string, <<"hello world">>, #config{}) + =:= [<<"\"">>, <<"hello world">>, <<"\"">>] + )}, + {"key", ?_assert(encode(key, <<"key">>, #config{}) =:= [<<"\"">>, <<"key">>, <<"\"">>])}, + {"1", ?_assert(encode(integer, 1, #config{}) =:= "1")}, + {"-1", ?_assert(encode(integer, -1, #config{}) =:= "-1")}, + {"true", ?_assert(encode(literal, true, #config{}) =:= "true")}, + {"false", ?_assert(encode(literal, false, #config{}) =:= "false")}, + {"null", ?_assert(encode(literal, null, #config{}) =:= "null")} + ]. + + +format_test_() -> + % {minified version, pretty version} + Cases = [ + {"empty object", <<"{}">>, <<"{}">>}, + {"empty array", <<"[]">>, <<"[]">>}, + {"single key object", <<"{\"k\":\"v\"}">>, <<"{\n \"k\": \"v\"\n}">>}, + {"single member array", <<"[true]">>, <<"[\n true\n]">>}, + {"multiple key object", + <<"{\"k\":\"v\",\"x\":\"y\"}">>, + <<"{\n \"k\": \"v\",\n \"x\": \"y\"\n}">> + }, + {"multiple member array", + <<"[1.0,2.0,3.0]">>, + <<"[\n 1.0,\n 2.0,\n 3.0\n]">> + }, + {"nested structure", + <<"[[{},[],true],{\"k\":\"v\",\"x\":\"y\"}]">>, + <<"[\n [\n {},\n [],\n true\n ],\n {\n \"k\": \"v\",\n \"x\": \"y\"\n }\n]">> + } + ], + [{Title, ?_assertEqual(Min, jsx:minify(Pretty))} || {Title, Min, Pretty} <- Cases] ++ + [{Title, ?_assertEqual(Pretty, jsx:prettify(Min))} || {Title, Min, Pretty} <- Cases]. + +custom_newline_test_() -> + [ + {"single key object", ?_assert( + jsx:format(<<"{\"k\":\"v\"}">>, [space, {indent, 2}, {newline, <<$\r>>}]) + =:= <<"{\r \"k\": \"v\"\r}">>) + } + ]. + +handle_event_test_() -> + Data = jsx:test_cases() ++ jsx:special_test_cases(), + [ + { + Title, ?_assertEqual( + JSON, + lists:foldl(fun handle_event/2, init([]), Events ++ [end_json]) + ) + } || {Title, JSON, _, Events} <- Data + ]. + + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_to_term.erl b/server/_build/default/lib/jsx/src/jsx_to_term.erl new file mode 100644 index 0000000..07beba4 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_to_term.erl @@ -0,0 +1,389 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 Alisdair Sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_to_term). + +-export([to_term/2]). +-export([init/1, handle_event/2]). +-export([ + start_term/1, + start_object/1, + start_array/1, + finish/1, + insert/2, + get_key/1, + get_value/1 +]). + + +-record(config, { + labels = binary, + return_maps = false +}). + +-type config() :: proplists:proplist(). + +-spec to_term(Source::binary(), Config::jsx_config:options()) -> jsx:json_term() | {incomplete, jsx:decoder()}. + +to_term(Source, Config) when is_list(Config) -> + (jsx:decoder(?MODULE, [return_maps] ++ Config, jsx_config:extract_config(Config)))(Source). + +parse_config(Config) -> parse_config(Config, #config{}). + +parse_config([{labels, Val}|Rest], Config) + when Val == binary; Val == atom; Val == existing_atom; Val == attempt_atom -> + parse_config(Rest, Config#config{labels = Val}); +parse_config([labels|Rest], Config) -> + parse_config(Rest, Config#config{labels = binary}); +parse_config([{return_maps, Val}|Rest], Config) + when Val == true; Val == false -> + parse_config(Rest, Config#config{return_maps = Val}); +parse_config([return_maps|Rest], Config) -> + parse_config(Rest, Config#config{return_maps = true}); +parse_config([{K, _}|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config) + ; false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([K|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config) + ; false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([], Config) -> + Config. + + +-type state() :: {list(), #config{}}. +-spec init(Config::config()) -> state(). + +init(Config) -> start_term(Config). + +-spec handle_event(Event::any(), State::state()) -> state(). + +handle_event(end_json, State) -> get_value(State); + +handle_event(start_object, State) -> start_object(State); +handle_event(end_object, State) -> finish(State); + +handle_event(start_array, State) -> start_array(State); +handle_event(end_array, State) -> finish(State); + +handle_event({key, Key}, {_, Config} = State) -> insert(format_key(Key, Config), State); + +handle_event({_, Event}, State) -> insert(Event, State). + + +format_key(Key, Config) -> + case Config#config.labels of + binary -> Key + ; atom -> binary_to_atom(Key, utf8) + ; existing_atom -> binary_to_existing_atom(Key, utf8) + ; attempt_atom -> + try binary_to_existing_atom(Key, utf8) of + Result -> Result + catch + error:badarg -> Key + end + end. + + +%% internal state is a stack and a config object +%% `{Stack, Config}` +%% the stack is a list of in progress objects/arrays +%% `[Current, Parent, Grandparent,...OriginalAncestor]` +%% an object has the representation on the stack of +%% `{object, [ +%% {NthKey, NthValue}, +%% {NMinus1Key, NthMinus1Value}, +%% ..., +%% {FirstKey, FirstValue} +%% ]}` +%% or if returning maps +%% `{object, #{ +%% FirstKey => FirstValue, +%% SecondKey => SecondValue, +%% ..., +%% NthKey => NthValue +%% }}` +%% or if there's a key with a yet to be matched value +%% `{object, Key, ...}` +%% an array looks like +%% `{array, [NthValue, NthMinus1Value,...FirstValue]}` + +start_term(Config) when is_list(Config) -> {[], parse_config(Config)}. + +%% allocate a new object on top of the stack +start_object({Stack, Config=#config{return_maps=true}}) -> + {[{object, #{}}] ++ Stack, Config}; +start_object({Stack, Config}) -> + {[{object, []}] ++ Stack, Config}. + + +%% allocate a new array on top of the stack +start_array({Stack, Config}) -> {[{array, []}] ++ Stack, Config}. + + +%% finish an object or array and insert it into the parent object if it exists or +%% return it if it is the root object +finish({[{object, Map}], Config=#config{return_maps=true}}) -> {Map, Config}; +finish({[{object, Map}|Rest], Config=#config{return_maps=true}}) -> insert(Map, {Rest, Config}); +finish({[{object, []}], Config}) -> {[{}], Config}; +finish({[{object, []}|Rest], Config}) -> insert([{}], {Rest, Config}); +finish({[{object, Pairs}], Config}) -> {lists:reverse(Pairs), Config}; +finish({[{object, Pairs}|Rest], Config}) -> insert(lists:reverse(Pairs), {Rest, Config}); +finish({[{array, Values}], Config}) -> {lists:reverse(Values), Config}; +finish({[{array, Values}|Rest], Config}) -> insert(lists:reverse(Values), {Rest, Config}); +finish(_) -> erlang:error(badarg). + + +%% insert a value when there's no parent object or array +insert(Value, {[], Config}) -> {Value, Config}; +%% insert a key or value into an object or array, autodetects the 'right' thing +insert(Key, {[{object, Map}|Rest], Config=#config{return_maps=true}}) -> + {[{object, Key, Map}] ++ Rest, Config}; +insert(Key, {[{object, Pairs}|Rest], Config}) -> + {[{object, Key, Pairs}] ++ Rest, Config}; +insert(Value, {[{object, Key, Map}|Rest], Config=#config{return_maps=true}}) -> + {[{object, maps:put(Key, Value, Map)}] ++ Rest, Config}; +insert(Value, {[{object, Key, Pairs}|Rest], Config}) -> + {[{object, [{Key, Value}] ++ Pairs}] ++ Rest, Config}; +insert(Value, {[{array, Values}|Rest], Config}) -> + {[{array, [Value] ++ Values}] ++ Rest, Config}; +insert(_, _) -> erlang:error(badarg). + +get_key({[{object, Key, _}|_], _}) -> Key; +get_key(_) -> erlang:error(badarg). + + +get_value({Value, _Config}) -> Value; +get_value(_) -> erlang:error(badarg). + + + +%% eunit tests + +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +config_test_() -> + [ + {"empty config", ?_assertEqual(#config{}, parse_config([]))}, + {"implicit binary labels", ?_assertEqual(#config{}, parse_config([labels]))}, + {"binary labels", ?_assertEqual(#config{}, parse_config([{labels, binary}]))}, + {"atom labels", ?_assertEqual(#config{labels=atom}, parse_config([{labels, atom}]))}, + {"existing atom labels", ?_assertEqual( + #config{labels=existing_atom}, + parse_config([{labels, existing_atom}]) + )}, + {"return_maps true", ?_assertEqual( + #config{return_maps=true}, + parse_config([return_maps]) + )}, + {"invalid opt flag", ?_assertError(badarg, parse_config([error]))}, + {"invalid opt tuple", ?_assertError(badarg, parse_config([{error, true}]))} + ]. + + +format_key_test_() -> + [ + {"binary key", ?_assertEqual(<<"key">>, format_key(<<"key">>, #config{labels=binary}))}, + {"atom key", ?_assertEqual(key, format_key(<<"key">>, #config{labels=atom}))}, + {"existing atom key", ?_assertEqual( + key, + format_key(<<"key">>, #config{labels=existing_atom}) + )}, + {"nonexisting atom key", ?_assertError( + badarg, + format_key(<<"nonexistentatom">>, #config{labels=existing_atom}) + )}, + {"sloppy existing atom key", ?_assertEqual( + key, + format_key(<<"key">>, #config{labels=attempt_atom}) + )}, + {"nonexisting atom key", ?_assertEqual( + <<"nonexistentatom">>, + format_key(<<"nonexistentatom">>, #config{labels=attempt_atom}) + )} + ]. + + +rep_manipulation_test_() -> + [ + {"allocate a new context with option", ?_assertEqual( + {[], #config{labels=atom}}, + start_term([{labels, atom}]) + )}, + {"allocate a new object on an empty stack", ?_assertEqual( + {[{object, []}], #config{}}, + start_object({[], #config{}}) + )}, + {"allocate a new object on a stack", ?_assertEqual( + {[{object, []}, {object, []}], #config{}}, + start_object({[{object, []}], #config{}}) + )}, + {"allocate a new array on an empty stack", ?_assertEqual( + {[{array, []}], #config{}}, + start_array({[], #config{}}) + )}, + {"allocate a new array on a stack", ?_assertEqual( + {[{array, []}, {object, []}], #config{}}, + start_array({[{object, []}], #config{}}) + )}, + {"insert a key into an object", ?_assertEqual( + {[{object, key, []}, junk], #config{}}, + insert(key, {[{object, []}, junk], #config{}}) + )}, + {"get current key", ?_assertEqual( + key, + get_key({[{object, key, []}], #config{}}) + )}, + {"try to get non-key from object", ?_assertError( + badarg, + get_key({[{object, []}], #config{}}) + )}, + {"try to get key from array", ?_assertError( + badarg, + get_key({[{array, []}], #config{}}) + )}, + {"insert a value into an object", ?_assertEqual( + {[{object, [{key, value}]}, junk], #config{}}, + insert(value, {[{object, key, []}, junk], #config{}}) + )}, + {"insert a value into an array", ?_assertEqual( + {[{array, [value]}, junk], #config{}}, + insert(value, {[{array, []}, junk], #config{}}) + )}, + {"finish an object with no ancestor", ?_assertEqual( + {[{a, b}, {x, y}], #config{}}, + finish({[{object, [{x, y}, {a, b}]}], #config{}}) + )}, + {"finish an empty object", ?_assertEqual( + {[{}], #config{}}, + finish({[{object, []}], #config{}}) + )}, + {"finish an object with an ancestor", ?_assertEqual( + {[{object, [{key, [{a, b}, {x, y}]}, {foo, bar}]}], #config{}}, + finish({[{object, [{x, y}, {a, b}]}, {object, key, [{foo, bar}]}], #config{}}) + )}, + {"finish an array with no ancestor", ?_assertEqual( + {[a, b, c], #config{}}, + finish({[{array, [c, b, a]}], #config{}}) + )}, + {"finish an array with an ancestor", ?_assertEqual( + {[{array, [[a, b, c], d, e, f]}], #config{}}, + finish({[{array, [c, b, a]}, {array, [d, e, f]}], #config{}}) + )} + ]. + + +rep_manipulation_with_maps_test_() -> + [ + {"allocate a new object on an empty stack", ?_assertEqual( + {[{object, #{}}], #config{return_maps=true}}, + start_object({[], #config{return_maps=true}}) + )}, + {"allocate a new object on a stack", ?_assertEqual( + {[{object, #{}}, {object, #{}}], #config{return_maps=true}}, + start_object({[{object, #{}}], #config{return_maps=true}}) + )}, + {"insert a key into an object", ?_assertEqual( + {[{object, key, #{}}, junk], #config{return_maps=true}}, + insert(key, {[{object, #{}}, junk], #config{return_maps=true}}) + )}, + {"get current key", ?_assertEqual( + key, + get_key({[{object, key, #{}}], #config{return_maps=true}}) + )}, + {"try to get non-key from object", ?_assertError( + badarg, + get_key({[{object, #{}}], #config{return_maps=true}}) + )}, + {"insert a value into an object", ?_assertEqual( + {[{object, #{key => value}}, junk], #config{return_maps=true}}, + insert(value, {[{object, key, #{}}, junk], #config{return_maps=true}}) + )}, + {"finish an object with no ancestor", ?_assertEqual( + {#{a => b, x => y}, #config{return_maps=true}}, + finish({[{object, #{x => y, a => b}}], #config{return_maps=true}}) + )}, + {"finish an empty object", ?_assertEqual( + {#{}, #config{return_maps=true}}, + finish({[{object, #{}}], #config{return_maps=true}}) + )}, + {"finish an object with an ancestor", ?_assertEqual( + { + [{object, #{key => #{a => b, x => y}, foo => bar}}], + #config{return_maps=true} + }, + finish({ + [{object, #{x => y, a => b}}, {object, key, #{foo => bar}}], + #config{return_maps=true} + }) + )} + ]. + + +return_maps_test_() -> + [ + {"an empty map", ?_assertEqual( + #{}, + jsx:decode(<<"{}">>, []) + )}, + {"an empty map", ?_assertEqual( + #{}, + jsx:decode(<<"{}">>, []) + )}, + {"an empty map", ?_assertEqual( + [{}], + jsx:decode(<<"{}">>, [{return_maps, false}]) + )}, + {"a small map", ?_assertEqual( + #{<<"awesome">> => true, <<"library">> => <<"jsx">>}, + jsx:decode(<<"{\"library\": \"jsx\", \"awesome\": true}">>, []) + )}, + {"a recursive map", ?_assertEqual( + #{<<"key">> => #{<<"key">> => true}}, + jsx:decode(<<"{\"key\": {\"key\": true}}">>, []) + )}, + {"a map inside a list", ?_assertEqual( + [#{}], + jsx:decode(<<"[{}]">>, []) + )} + ]. + + +handle_event_test_() -> + Data = jsx:test_cases(), + [ + { + Title, ?_assertEqual( + Term, + lists:foldl(fun handle_event/2, init([]), Events ++ [end_json]) + ) + } || {Title, _, Term, Events} <- Data + ]. + + +-endif. diff --git a/server/_build/default/lib/jsx/src/jsx_verify.erl b/server/_build/default/lib/jsx/src/jsx_verify.erl new file mode 100644 index 0000000..5eef4d2 --- /dev/null +++ b/server/_build/default/lib/jsx/src/jsx_verify.erl @@ -0,0 +1,121 @@ +%% The MIT License + +%% Copyright (c) 2010-2013 alisdair sullivan + +%% Permission is hereby granted, free of charge, to any person obtaining a copy +%% of this software and associated documentation files (the "Software"), to deal +%% in the Software without restriction, including without limitation the rights +%% to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +%% copies of the Software, and to permit persons to whom the Software is +%% furnished to do so, subject to the following conditions: + +%% The above copyright notice and this permission notice shall be included in +%% all copies or substantial portions of the Software. + +%% THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +%% IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +%% FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +%% AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +%% LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +%% OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +%% THE SOFTWARE. + + +-module(jsx_verify). + +-export([is_json/2, is_term/2]). +-export([init/1, handle_event/2]). + +-type config() :: proplists:proplist(). + +-spec is_json(Source::binary(), Config::jsx_config:options()) -> true | false | {incomplete, jsx:decoder()}. + +is_json(Source, Config) when is_list(Config) -> + try (jsx:decoder(?MODULE, Config, jsx_config:extract_config(Config)))(Source) + catch error:badarg -> false + end. + + +-spec is_term(Source::jsx:json_term() | end_stream | end_json, + Config::jsx_config:options()) -> true | false | {incomplete, jsx:encoder()}. + +is_term(Source, Config) when is_list(Config) -> + try (jsx:encoder(?MODULE, Config, jsx_config:extract_config(Config)))(Source) + catch error:badarg -> false + end. + + +parse_config(Config) -> parse_config(Config, []). + +%% ignore deprecated flags +parse_config([no_repeated_keys|Rest], Config) -> + parse_config(Rest, Config); +parse_config([{repeated_keys, Val}|Rest], Config) when Val == true; Val == false -> + parse_config(Rest, Config); +parse_config([repeated_keys|Rest], Config) -> + parse_config(Rest, Config); +parse_config([{K, _}|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config); + false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([K|Rest] = Options, Config) -> + case lists:member(K, jsx_config:valid_flags()) of + true -> parse_config(Rest, Config); + false -> erlang:error(badarg, [Options, Config]) + end; +parse_config([], Config) -> + Config. + + +%% we don't actually need any state for this +-type state() :: []. +-spec init(Config::config()) -> state(). + +init(Config) -> parse_config(Config). + + +-spec handle_event(Event::any(), State::state()) -> state(). + +handle_event(end_json, _) -> true; + +handle_event(_, State) -> State. + + + +%% eunit tests +-ifdef(TEST). +-include_lib("eunit/include/eunit.hrl"). + + +config_test_() -> + [ + {"empty config", ?_assertEqual([], parse_config([]))}, + {"no repeat keys", ?_assertEqual([], parse_config([no_repeated_keys]))}, + {"bare repeated keys", ?_assertEqual([], parse_config([repeated_keys]))}, + {"repeated keys true", ?_assertEqual( + [], + parse_config([{repeated_keys, true}]) + )}, + {"repeated keys false", ?_assertEqual( + [], + parse_config([{repeated_keys, false}]) + )}, + {"invalid opt flag", ?_assertError(badarg, parse_config([error]))}, + {"invalid opt tuple", ?_assertError(badarg, parse_config([{error, true}]))} + ]. + + +handle_event_test_() -> + Data = jsx:test_cases() ++ jsx:special_test_cases(), + [ + { + Title, ?_assertEqual( + true, + lists:foldl(fun handle_event/2, [], Events ++ [end_json]) + ) + } || {Title, _, _, Events} <- Data + ]. + + +-endif. -- cgit v1.2.3